
CAS Number5344-78-5
Synonyms4-Methoxy-2-nitrophenyl bromide; 4-BroMo-3-nitroanisole; 4-methoxy-2-nitrobromobenzene; 4-BROMO-3-NITROTHIOANISOLE; 1-bromo-4-methoxy-2-nitro-benzene; EINECS 226-290-0; MFCD00051511; 1-bromo-2-nitro-4-methoxybenzene; 4-Bromo-3-nitrophenyl methyl ether; 4-Bromo-3-nitroanisol; 4-bromo-3-nitrobenzyl ether; 2-bromo-5-methoxynitrobenzene; 2-bromo-5-methoxy-1-nitrobenzene; 1-Bromo-4-methoxy-2-nitrobenzene; WNR BE EO1; 1-Nitro-2-bromo-5-methoxybenzene
Molecular FormulaBrC6H3(NO2)OCH3
Molecular Weight232.03
Purity97%
Density1.6±0.1 g/cm3
Boiling Point153-154 °C/13 mmHg (lit.)
Melting Point32-34 °C (lit.)
Appearancesolid
EINECS226-290-0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5344-78-5 |
| Catalog No. | 2A-9031680 |
| Chinese Name | 4-溴-3-硝基苯甲醚 |
| Synonyms | 4-Methoxy-2-nitrophenyl bromide; 4-BroMo-3-nitroanisole; 4-methoxy-2-nitrobromobenzene; 4-BROMO-3-NITROTHIOANISOLE; 1-bromo-4-methoxy-2-nitro-benzene; EINECS 226-290-0; MFCD00051511; 1-bromo-2-nitro-4-methoxybenzene; 4-Bromo-3-nitrophenyl methyl ether; 4-Bromo-3-nitroanisol; 4-bromo-3-nitrobenzyl ether; 2-bromo-5-methoxynitrobenzene; 2-bromo-5-methoxy-1-nitrobenzene; 1-Bromo-4-methoxy-2-nitrobenzene; WNR BE EO1; 1-Nitro-2-bromo-5-methoxybenzene |
| Molecular Formula | BrC6H3(NO2)OCH3 |
| Molecular Weight | 232.03 |
| Purity | 97 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 153-154 °C/13 mmHg (lit.) |
| Melting Point | 32-34 °C (lit.) |
| Appearance | solid |
| Storage Condition | Store in a cool and dry place away from light, sea |
| EINECS | 226-290-0 |
| HTC | 2909309090 |
| PubChem ID | 24860568 |
| MDL Number | MFCD00051511 |
| SMILES | COc1ccc(Br)c(c1)[N+]([O-])=O |
| InChI | 1S/C7H6BrNO3/c1-12-5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3 |
| InChI Key | KCOBIBRGPCFIGF-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/31680_2_5344_78_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4'-Methylpropiophenone | 5337-93-9 | 2A-9031671 |
| Hydrazine dihydrochloride | 5341-61-7 | 2A-9031674 |
| tert-Butyl 3,5-dinitrobenzoate | 5342-97-2 | 2A-9031675 |
| 2-Carboxy-5-nitrobenzenesulfonic acid potassium salt | 5344-48-9 | 2A-9031678 |
| 2-Chloro-6-nitro-benzoic acid | 5344-49-0 | 2A-9031679 |
| 1-(2-Chlorophenyl)-2-thiourea | 5344-82-1 | 2A-9031681 |
| 3-Methylsulphonylbenzoic acid | 5345-27-7 | 2A-9031683 |
| 3-Methyl-2-nitroanisole | 5345-42-6 | 2A-9031684 |
| 1,4-Diacetamino-2-nitrobenzene | 5345-53-9 | 2A-9031686 |
| 3-Chloro-4-methoxyaniline | 5345-54-0 | 2A-9031687 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA