
CAS Number5329-33-9
SynonymsCarbamimidic acid, methyl ester, monohydrochloride; Pseudourea, 2-methyl-, monohydrochloride; O-Methylisourea hydrochloride; Carbamimidic acid, methyl ester, hydrochloride (1:1); Methyl carbamimidate hydrochloride (1:1); MFCD00035043; methyl carbamimidate,hydrochloride
Molecular FormulaC2H7ClN2O
Molecular Weight110.543
Purity98.00%
Density1.17g/cm3
Boiling Point66.9ºC at 760mmHg
Melting Point116-119°C (dec.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5329-33-9 |
| Catalog No. | 2A-9031645 |
| Chinese Name | O-甲基异脲盐酸盐 |
| Synonyms | Carbamimidic acid, methyl ester, monohydrochloride; Pseudourea, 2-methyl-, monohydrochloride; O-Methylisourea hydrochloride; Carbamimidic acid, methyl ester, hydrochloride (1:1); Methyl carbamimidate hydrochloride (1:1); MFCD00035043; methyl carbamimidate,hydrochloride |
| Molecular Formula | C2H7ClN2O |
| Molecular Weight | 110.543 |
| Purity | 98.00 |
| Density | 1.17g/cm3 |
| Boiling Point | 66.9ºC at 760mmHg |
| Melting Point | 116-119°C (dec.) |
| Storage Condition | Avoid light, keep in a cool and dry place, sealed |
| HTC | 2925290090 |
| SMILES | COC(=N)N.Cl |
| InChI | InChI=1S/C2H6N2O.ClH/c1-5-2(3)4;/h1H3,(H3,3,4);1H |
| InChI Key | MUDVUWOLBJRUGF-UHFFFAOYSA-N |
| MSDS | msds/31645_1_5329_33_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2925290090 other imines and their derivatives; salts thereof. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,5-Dimethyl-4-hydroxyacetophenone | 5325-04-2 | 2A-9031632 |
| 2-Chloro-N,N-bis(2-methylpropyl)acetamide | 5326-82-9 | 2A-9031639 |
| 3,5-Dinitroanisole | 5327-44-6 | 2A-9031641 |
| L-Arabinose | 5328-37-0 | 2A-9031642 |
| 2,4,6-Trichlorophenylhydrazine | 5329-12-4 | 2A-9031643 |
| 1-Methylpentylamine | 5329-79-3 | 2A-0201354 |
| 2-Octyl-1-dodecanol | 5333-42-6 | 2A-9031655 |
| Ethyl benzimidate hydrochloride | 5333-86-8 | 2A-9031657 |
| Ethyl 2-bromoheptanoate | 5333-88-0 | 2A-9031658 |
| Bis(4-methoxyphenyl) disulfide | 5335-87-5 | 2A-9031664 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA