
CAS Number5314-37-4
Synonyms[1,1'-Biphenyl]-4,4'-disulfonic acid; 4-(4-sulfophenyl)benzenesulfonic acid; EINECS 226-169-2; MFCD00035762; 4,4'-Biphenyldisulphonic acid; 4,4'-Biphenyldisulfonic acid
Molecular FormulaC12H10O6S2
Molecular Weight314.34
Purity98.00%
Density1.6±0.1 g/cm3
Melting Point143-145 °C(lit.)
AppearanceSolid;White to Gray to Red powder to crystal
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5314-37-4 |
| Catalog No. | 2A-9031620 |
| Chinese Name | 4,4'-联苯二磺酸 |
| Synonyms | [1,1'-Biphenyl]-4,4'-disulfonic acid; 4-(4-sulfophenyl)benzenesulfonic acid; EINECS 226-169-2; MFCD00035762; 4,4'-Biphenyldisulphonic acid; 4,4'-Biphenyldisulfonic acid |
| Molecular Formula | C12H10O6S2 |
| Molecular Weight | 314.34 |
| Purity | 98.00 |
| Density | 1.6±0.1 g/cm3 |
| Melting Point | 143-145 °C(lit.) |
| Appearance | Solid;White to Gray to Red powder to crystal |
| Storage Condition | Store at room temperature, away from light, in a c |
| Packaging | III |
| HTC | 2904100000 |
| MDL Number | MFCD00035762 |
| SMILES | O=S(=O)(O)c1ccc(-c2ccc(S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C12H10O6S2.Na/c13-19(14,15)11-5-1-9(2-6-11)10-3-7-12(8-4-10)20(16,17)18;/h1-8H,(H,13,14,15)(H,16,17,18);/q;+1 |
| InChI Key | ABSXMLODUTXQDJ-UHFFFAOYSA-N |
| Hazard Symbols | 8.0 |
| MSDS | msds/31620_1_5314_37_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Class 8 Corrosives UN number: 2585 Formal shipping name: Arylsulfonic acid, solid Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chloro-5-methyl-1,4-phenylenediamine | 5307-03-9 | 2A-9031613 |
| 1,4-Diamino-2-nitrobenzene | 5307-14-2 | 2A-9031614 |
| 1-(5-Methylpyridin-2-yl)ethanone | 5308-63-4 | 2A-9031617 |
| 4-(4-Methoxyphenyl)cyclohexanone | 5309-16-0 | 2A-9031618 |
| 8-Methoxy-2-tetralone | 5309-19-3 | 2A-9031619 |
| N-(4-Acetylphenyl)methanesulfonamide | 5317-89-5 | 2A-9031623 |
| Imidocarb dihydrochloride | 5318-76-3 | 2A-9031625 |
| (2-Fluorophenylamino)acetic acid | 5319-42-6 | 2A-9031626 |
| Benzophone imine hydrochloride | 5319-67-5 | 2A-9031627 |
| 2-Amino-5-methylthio-1,3,4-thidiazole | 5319-77-7 | 2A-9031628 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA