
CAS Number5081-42-5
SynonymsMethyl 6-nitro-3,4,5-trimethoxybenzoate; MFCD00007097; EINECS 225-794-8; 3,4,5-trimethoxy-2-nitrobenzoic acid methyl ester; Benzoic acid,3,4,5-trimethoxy-2-nitro-,methyl ester; 3,4,5-Trimethoxy-2-nitro-benzoesaeure-methylester; methyl-2-nitro-3,4,5-trimethoxybenzoate; Trimethylaether-nitrogallussaeure-methylester
Molecular FormulaC11H13BrO5
Molecular Weight305.127
Purity98.00%
Density1.284g/cm3
Boiling Point420ºC at 760mmHg
Melting Point67-69ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5081-42-5 |
| Catalog No. | 2A-9031429 |
| Chinese Name | 2-硝基-3,4,5-三甲氧基苯甲酸甲酯 |
| Synonyms | Methyl 6-nitro-3,4,5-trimethoxybenzoate; MFCD00007097; EINECS 225-794-8; 3,4,5-trimethoxy-2-nitrobenzoic acid methyl ester; Benzoic acid,3,4,5-trimethoxy-2-nitro-,methyl ester; 3,4,5-Trimethoxy-2-nitro-benzoesaeure-methylester; methyl-2-nitro-3,4,5-trimethoxybenzoate; Trimethylaether-nitrogallussaeure-methylester |
| Molecular Formula | C11H13BrO5 |
| Molecular Weight | 305.127 |
| Purity | 98.00 |
| Density | 1.284g/cm3 |
| Boiling Point | 420ºC at 760mmHg |
| Melting Point | 67-69ºC |
| Storage Condition | Store at room temperature, away from light, in a c |
| HTC | 2918990090 |
| MDL Number | MFCD00095002 |
| SMILES | COC(=O)c1cc(OC)c(OC)c(OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13NO7/c1-16-7-5-6(11(13)19-4)8(12(14)15)10(18-3)9(7)17-2/h5H,1-4H3 |
| InChI Key | HCEIEWYPDCDNNU-UHFFFAOYSA-N |
| MSDS | msds/31429_1_5081_42_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Trisodium nitrilotriacetate | 5064-31-3 | 2A-9031419 |
| Bis(4-nitrophenyl) carbonate | 5070-13-3 | 2A-9031422 |
| 3-Methoxybenzylamine | 5071-96-5 | 2A-9031423 |
| N-Isopropylhydroxylamine | 5080-22-8 | 2A-9031425 |
| Methyl 3-methoxy-4-nitrobenzoate | 5081-37-8 | 2A-9031428 |
| Tetramisole hydrochloride | 5086-74-8 | 2A-9031432 |
| Liensinine diperchlorate | 5088-90-4 | 2A-9031433 |
| 3-Chloropropyltriethoxysilane | 5089-70-3 | 2A-9031435 |
| N-(3-Triethoxysilylpropyl)ethylenediamine | 5089-72-5 | 2A-9031436 |
| 4-(4-Chlorophenyl)-1H-1,2,4-triazol-5(4H)-one | 5097-86-9 | 2A-9031440 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA