![3-Nitroimidazo[1,2-a]pyridine structure, CAS 4926-45-8](/structures/40000/31323_1_4926_45_8.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4926-45-8 |
| Catalog No. | 2A-9031323 |
| Chinese Name | 3-硝基咪唑并[1,2-a]吡啶 |
| Synonyms | 3-nitroimidazo[1,2-a]pyridine; MFCD00014557 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 |
| Purity | 98.00 |
| Density | 1.49 g/cm3 |
| Melting Point | 204-206ºC |
| Appearance | Yellow to brown solid |
| Storage Condition | Store at room temperature, away from light, in a c |
| HTC | 2933990090 |
| MDL Number | MFCD11502965 |
| SMILES | O=[N+]([O-])c1cnc2ccccn12 |
| InChI | InChI=1S/C7H5N3O2/c11-10(12)7-5-8-6-3-1-2-4-9(6)7/h1-5H |
| InChI Key | WYDBFRQNRYIZSL-UHFFFAOYSA-N |
| MSDS | msds/31323_1_4926_45_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| (S)-(-)-Tetrahydropapaverine | 4747-98-2 | 2A-9031170 |
| 1,4-Dichlorophthalazine | 4752-10-7 | 2A-9031172 |
| Cyclohexanesulfonyl chloride | 4837-38-1 | 2A-9031253 |
| 1-Tetradecyl isocyanate | 4877-14-9 | 2A-9031291 |
| 6-Chloro-4-methyl-7-azaindole | 4894-29-5 | 2A-9031302 |
| 3-Bromoimidazo[1,2-a]pyridine | 4926-47-0 | 2A-9031324 |
| (R)-(-)-1-Methoxy-2-propanol | 4984-22-9 | 2A-9031358 |
| Thiazolo[5,4-d]pyrimidine-5,7(4H,6H)-dione | 5082-82-6 | 2A-9031431 |
| Methylene-bis(4-cyclohexylisocyanate) | 5124-30-1 | 2A-9031467 |
| N-Boc-pyrrole | 5176-27-2 | 2A-9031508 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA