
CAS Number4890-85-1
SynonymsEINECS 225-511-8; MFCD02093269; 2-(2-Phenylethyl)benzoic acid
Molecular FormulaC15H14O2
Molecular Weight226.27
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point358.4±11.0 °C at 760 mmHg
Melting Point127-132 °C
AppearanceWhite to off-white crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4890-85-1 |
| Catalog No. | 2A-9031298 |
| Chinese Name | 邻苯乙基苯甲酸 |
| Synonyms | EINECS 225-511-8; MFCD02093269; 2-(2-Phenylethyl)benzoic acid |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 358.4±11.0 °C at 760 mmHg |
| Melting Point | 127-132 °C |
| Appearance | White to off-white crystalline powder |
| Storage Condition | Store airtight in a cool, dry warehouse. |
| HTC | 2916399090 |
| MDL Number | MFCD00002485 |
| SMILES | O=C(O)c1ccccc1CCc1ccccc1 |
| InChI | InChI=1S/C15H14O2/c16-15(17)14-9-5-4-8-13(14)11-10-12-6-2-1-3-7-12/h1-9H,10-11H2,(H,16,17)/p-1 |
| InChI Key | IOHPVZBSOKLVMN-UHFFFAOYSA-N |
| MSDS | msds/31298_1_4890_85_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-Cyclohexenecarboxylic acid | 4771-80-6 | 2A-9031192 |
| 3-(4-METHOXYPHENOXY)BENZALDEHYDE | 62373-80-2 | 2A-9031226 |
| 2-Methoxy-5-(trifluoromethyl)benzoic acid | 4864-01-1 | 2A-9031280 |
| 1,3-Dimethyluracil-5-carboxaldehyde | 4869-46-9 | 2A-9031283 |
| 4-(4-Methoxyphenyl)-2(3H)-thiazolone hydrazone | 4871-25-4 | 2A-9031286 |
| Alphasone acetonide | 4968-09-6 | 2A-9031351 |
| Diethyl trans-4-cyclohexene-1,2-dicarboxylate | 5048-50-0 | 2A-9031405 |
| 2-Acetyl-5-norbornene | 5063-03-6 | 2A-9031418 |
| 2-Diphenylacetyl-1,3-indandione-1-hydrazone | 5102-79-4 | 2A-9031444 |
| Pyridine-2,6-dicarbohydrazide | 5112-36-7 | 2A-9031453 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA