CAS Number4815-30-9
Synonymsdiethyl 5-amino-3-methylthiophene-2,4-dicarboxylate; MFCD00005450; EINECS 225-388-0; Diethyl 5-Amino-3-methyl-2,4-thiophenedicarboxylate; 5-Amino-3-methyl-2,4-thiophenedicarboxylic Acid Diethyl Ester; 2-Amino-3,5-bis(ethoxycarbonyl)-4-methylthiophene
Molecular FormulaC11H15NO4S
Molecular Weight257.30600
Purity98.00%
Density1.247 g/cm3
Boiling Point372.6ºC at 760 mmHg
Melting Point105-108 °C(lit.)
AppearanceSlightly yellow to beige - yellow crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4815-30-9 |
| Catalog No. | 2A-9031239 |
| Chinese Name | 5-氨基-3-甲基-2,4-噻酚二羧酸二乙酯 |
| Synonyms | diethyl 5-amino-3-methylthiophene-2,4-dicarboxylate; MFCD00005450; EINECS 225-388-0; Diethyl 5-Amino-3-methyl-2,4-thiophenedicarboxylate; 5-Amino-3-methyl-2,4-thiophenedicarboxylic Acid Diethyl Ester; 2-Amino-3,5-bis(ethoxycarbonyl)-4-methylthiophene |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.30600 |
| Purity | 98.00 |
| Density | 1.247 g/cm3 |
| Boiling Point | 372.6ºC at 760 mmHg |
| Melting Point | 105-108 °C(lit.) |
| Appearance | Slightly yellow to beige - yellow crystalline powder |
| Storage Condition | Store at room temperature, away from light, in a c |
| HTC | 2934999090 |
| SMILES | CCOC(=O)c1sc(N)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C11H15NO4S/c1-4-15-10(13)7-6(3)8(17-9(7)12)11(14)16-5-2/h4-5,12H2,1-3H3 |
| InChI Key | DGVXLHAJVRRLGV-UHFFFAOYSA-N |
| MSDS | msds/31239_1_4815_30_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate Modification number: 5 Module 14. Shipping information UN number: not specified |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Dichloro-5-nitropyridine | 4487-56-3 | 2A-9030956 |
| 2,4-Dibromo-5-nitropyridine | 4487-57-4 | 2A-9030957 |
| Paraquat | 4685-14-7 | 2A-9031116 |
| 2,4-Dihydroxy-3,6-dimethylbenzoic acid | 4707-46-4 | 2A-9031129 |
| Methyl 2,4-dihydroxy-3,6-dimethylbenzoate | 4707-47-5 | 2A-9031130 |
| 2,4-Dinitrophenylethyl alcohol | 4836-69-5 | 2A-9031250 |
| 5-Fluoro-3-methyl-1H-pyrimidine-2,4-dione | 4840-69-1 | 2A-9031258 |
| 2,4-Dimethoxy-1-nitrobenzene | 4920-84-7 | 2A-9031319 |
| (2,4-Dichlorobenzyl)methylamine | 5013-77-4 | 2A-9031381 |
| 2,4-Dichloro-5-aminopyrimidine | 5177-27-5 | 2A-9031509 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS