
CAS Number85070-67-3
Synonyms2-fluoro-4-methylbenzenecarbonitrile; 4-methyl-2-fluorobenzonitrile; NCR BF D1; 2-fluoro-4-methyl-benzonitrile; 2-Fluoro-4-methylbenzonitrile; 4-Cyano-3-fluorotoluene; MFCD03094311; 2-Fluoro-p-tolunitrile
Molecular FormulaC8H6N1F1
Molecular Weight135.14
Purity98%
Density1.1±0.1 g/cm3
Boiling Point219.6±20.0 °C at 760 mmHg
Melting Point52-53°C
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 85070-67-3 |
| Catalog No. | 2A-9003119 |
| Chinese Name | 2-氟-4-甲基苯腈 |
| Synonyms | 2-fluoro-4-methylbenzenecarbonitrile; 4-methyl-2-fluorobenzonitrile; NCR BF D1; 2-fluoro-4-methyl-benzonitrile; 2-Fluoro-4-methylbenzonitrile; 4-Cyano-3-fluorotoluene; MFCD03094311; 2-Fluoro-p-tolunitrile |
| Molecular Formula | C8H6N1F1 |
| Molecular Weight | 135.14 |
| Purity | 98 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 219.6±20.0 °C at 760 mmHg |
| Melting Point | 52-53°C |
| Storage Condition | If used and stored according to regulations, it wi |
| Packaging | III |
| HTC | 2926909090 |
| MDL Number | MFCD03094311 |
| SMILES | Cc1ccc(C#N)c(F)c1 |
| InChI | InChI=1S/C8H6FN/c1-6-2-3-7(5-10)8(9)4-6/h2-4H,1H3 |
| InChI Key | WCGNLBCJPBKXCN-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| MSDS | msds/3119_1_85070_67_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Item 1 Poisons. UN number: 3439 Proper shipping name: Nitrile, Solid, Toxic, Not otherwise specified Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2'-Fluoro-4'-hydroxyacetophenone | 98619-07-9 | 2A-9003107 |
| 2-Fluoro-4-hydroxybenzonitrile | 82380-18-5 | 2A-9003109 |
| 2-Fluoro-4-methoxyacetophenone | 74457-86-6 | 2A-9003113 |
| 2-Fluoro-4-methoxybenzonitrile | 94610-82-9 | 2A-9003115 |
| 2-Fluoro-4-methylaniline | 452-80-2 | 2A-9003117 |
| 2-Fluoro-4-nitroanisole | 455-93-6 | 2A-9003121 |
| 2-Fluoro-4-nitrobenzoic acid | 403-24-7 | 2A-9003122 |
| 2-Fluoro-4-nitrobenzonitrile | 34667-88-4 | 2A-9003123 |
| 2-Fluoro-4-nitrobenzotrifluoride | 69411-67-2 | 2A-9003124 |
| 2-Fluoro-4-nitrophenol | 403-19-0 | 2A-9003125 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA