
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4596-23-0 |
| Catalog No. | 2A-9031061 |
| Chinese Name | 枸橼酸奥芬那君 |
| Synonyms | Norflex |
| Molecular Formula | C24H31NO8 |
| Molecular Weight | 461.50 |
| Purity | 98.00 |
| HTC | 2922199090 |
| PubChem ID | 329830844 |
| MDL Number | MFCD00079197 |
| SMILES | OC(=O)CC(CC(O)=O)C(O)=O.CN(C)CCOC(c1ccccc1)c2ccccc2C |
| InChI | 1S/C18H23NO.C6H8O6/c1-15-9-7-8-12-17(15)18(20-14-13-19(2)3)16-10-5-4-6-11-16;7-4(8)1-3(6(11)12)2-5(9)10/h4-12,18H,13-14H2,1-3H3;3H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChI Key | XLSFUJUURNFSCL-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/31061_1_4596_23_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(3,6-Dioxo-3,6-dihydro-1(2H)-pyridazinyl)propanoic acid | 4572-79-6 | 2A-9031041 |
| Tetradecyl trimethyl ammonium chloride | 4574-04-3 | 2A-9031043 |
| 2-Dimethylaminoethyl chloride hydrochloride | 4584-46-7 | 2A-0201326 |
| 5-Methyl-1-indanone | 4593-38-8 | 2A-9031051 |
| 3-Phenylbutyric acid | 4593-90-2 | 2A-9031053 |
| 5-Ethyl-2,3-dihydro-1H-inden-1-one | 4600-82-2 | 2A-9031063 |
| 5-tert-Butyl-2,3-dihydroinden-1-one | 4600-86-6 | 2A-9031064 |
| 3,3'-Diiodo-L-thyronine | 4604-41-5 | 2A-9031067 |
| 15-Hydroxypentadecanoic acid | 4617-33-8 | 2A-9031073 |
| Lactulose | 4618-18-2 | 2A-9031074 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA