CAS Number4502-00-5
SynonymsPentanoic acid, 4-methyl-2-oxo-, sodium salt (1:1); Pentanoic acid, 4-methyl-2-oxo-, sodium salt; Sodium 4-methyl-2-oxopentanoate; 4-Methyl-2-oxovaleric Acid Sodium Salt; A-ketoisocaproic acid sodium; Ketoleucine sodium; KETOLEUCINE SODIUM SALT; MFCD00064193; Sodium4-Methyl-2-oxopentanoate; SodiuM 2-Ketoisocaproate; EINECS 224-816-3; SODIUM 4-METHYL-2-OXOVALERATE; 2-Keto isocaproic acid sodiumsalt
Molecular Formula(CH3)2CHCH2COCOONa
Molecular Weight152.12
Purity>98 (TLC)%
Melting Point275 °C (dec.) (lit.)
Appearancepowder
EINECS224-816-3
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4502-00-5 |
| Catalog No. | 2A-9030974 |
| Chinese Name | 4-甲基-2-氧代戊酸钠盐 |
| Synonyms | Pentanoic acid, 4-methyl-2-oxo-, sodium salt (1:1); Pentanoic acid, 4-methyl-2-oxo-, sodium salt; Sodium 4-methyl-2-oxopentanoate; 4-Methyl-2-oxovaleric Acid Sodium Salt; A-ketoisocaproic acid sodium; Ketoleucine sodium; KETOLEUCINE SODIUM SALT; MFCD00064193; Sodium4-Methyl-2-oxopentanoate; SodiuM 2-Ketoisocaproate; EINECS 224-816-3; SODIUM 4-METHYL-2-OXOVALERATE; 2-Keto isocaproic acid sodiumsalt |
| Molecular Formula | (CH3)2CHCH2COCOONa |
| Molecular Weight | 152.12 |
| Purity | >98 (TLC) |
| Melting Point | 275 °C (dec.) (lit.) |
| Appearance | powder |
| Storage Condition | Store in an airtight, cool and dry place with good |
| EINECS | 224-816-3 |
| HTC | 2918300090 |
| PubChem ID | 24896196 |
| MDL Number | MFCD00064193 |
| SMILES | [Na+].CC(C)CC(=O)C([O-])=O |
| InChI | 1S/C6H10O3.Na/c1-4(2)3-5(7)6(8)9;/h4H,3H2,1-2H3,(H,8,9);/q;+1/p-1 |
| InChI Key | IXFAZKRLPPMQEO-UHFFFAOYSA-M |
| Beilstein/REAXYS | 4239297 |
| NACRES Code | NA.25 |
| UNSPSC | 12352107 |
| MSDS | msds/30974_1_4502_00_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-tert-Butyldiphenylamine | 4496-49-5 | 2A-9030963 |
| p-Sexiphenyl | 4499-83-6 | 2A-9030967 |
| Tetrapropylammonium hydroxide | 4499-86-9 | 2A-9030968 |
| 2-Ethylbenzenethiol | 4500-58-7 | 2A-9030970 |
| 4-Hydroxycinnamic acid | 4501-31-9 | 2A-9030972 |
| 1,2,4,5-Benzenetetramine tetrahydrochloride | 4506-66-5 | 2A-9030976 |
| 3-Nitro-1-naphthoic acid | 4507-84-0 | 2A-9030978 |
| Methioninamide | 4510-08-1 | 2A-9030980 |
| L-Lactide | 4511-42-6 | 2A-9030981 |
| Methyl corosolate | 4518-70-1 | 2A-9030985 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS