
CAS Number4476-28-2
Synonyms2-(4-Isopropylphenyl)acetic acid; EINECS 224-755-2; MFCD00041035; 4-Isopropylphenylacetic acid; (4-Isopropylphenyl)acetic acid; 2-(4-propan-2-ylphenyl)acetic acid; 4-ISOPROPYLPHENYLACETICACID
Molecular FormulaC11H14O2
Molecular Weight178.23
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point295.0±9.0 °C at 760 mmHg
Melting Point51-52°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4476-28-2 |
| Catalog No. | 2A-9030946 |
| Chinese Name | 4-异丙基苯乙酸 |
| Synonyms | 2-(4-Isopropylphenyl)acetic acid; EINECS 224-755-2; MFCD00041035; 4-Isopropylphenylacetic acid; (4-Isopropylphenyl)acetic acid; 2-(4-propan-2-ylphenyl)acetic acid; 4-ISOPROPYLPHENYLACETICACID |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 295.0±9.0 °C at 760 mmHg |
| Melting Point | 51-52°C |
| Storage Condition | Keep away from light, in a ventilated and dry plac |
| HTC | 2916399090 |
| MDL Number | MFCD00041035 |
| SMILES | CC(C)c1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C11H14O2/c1-8(2)10-5-3-9(4-6-10)7-11(12)13/h3-6,8H,7H2,1-2H3,(H,12,13)/p-1 |
| InChI Key | RERBQXVRXYCGLT-UHFFFAOYSA-N |
| MSDS | msds/30946_1_4476_28_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-Trityl-L-serine methyl ester | 4465-44-5 | 2A-9030933 |
| D-Histidine methyl ester dihydrochloride | 4467-54-3 | 2A-9030937 |
| 2-Phenylacetoacetonitrile | 4468-48-8 | 2A-9030939 |
| N-Carbobenzyloxy-D-asparagine | 4474-86-6 | 2A-9030944 |
| Angiotensin II | 4474-91-3 | 2A-9030945 |
| 4-Diazodiphenylamine sulfate | 4477-28-5 | 2A-9030947 |
| Diglycolic anhydride | 4480-83-5 | 2A-9030950 |
| Lithium stearate | 4485-12-5 | 2A-9030953 |
| [1,1'-Binaphthalene]-2,2'-diamine | 4488-22-6 | 2A-9030959 |
| 4-tert-Butyldiphenylamine | 4496-49-5 | 2A-9030963 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA