
CAS Number4350-41-8
SynonymsEINECS 224-412-7; MFCD00006353; 2-(para-Chlorobenzyl)-pyridine; 2-(4-Chlorobenzyl)pyridine; 2-[(4-chlorophenyl)methyl]pyridine
Molecular FormulaC12H10ClN
Molecular Weight203.673
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point312.8±0.0 °C at 760 mmHg
Melting Point8°C
Appearanceyellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4350-41-8 |
| Catalog No. | 2A-9030802 |
| Chinese Name | 2-对氯苄基吡啶 |
| Synonyms | EINECS 224-412-7; MFCD00006353; 2-(para-Chlorobenzyl)-pyridine; 2-(4-Chlorobenzyl)pyridine; 2-[(4-chlorophenyl)methyl]pyridine |
| Molecular Formula | C12H10ClN |
| Molecular Weight | 203.673 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 312.8±0.0 °C at 760 mmHg |
| Melting Point | 8°C |
| Appearance | yellow liquid |
| Storage Condition | Keep away from light, in a ventilated and dry plac |
| HTC | 2933399090 |
| MDL Number | MFCD00006353 |
| SMILES | Clc1ccc(Cc2ccccn2)cc1 |
| InChI | InChI=1S/C12H10ClN/c13-11-6-4-10(5-7-11)9-12-3-1-2-8-14-12/h1-8H,9H2 |
| InChI Key | XSVWMIMFDMJQRL-UHFFFAOYSA-N |
| MSDS | msds/30802_1_4350_41_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| N-Aminomorpholine | 4319-49-7 | 2A-9030769 |
| 2-Anilinomethylpyridine | 4329-81-1 | 2A-9030775 |
| Methyl 2-deoxy-3,5-di-O-toluoyl-D-ribofuranoside | 4330-34-1 | 2A-9030776 |
| 2-(2-Thiophenylmethyl)thiophene | 4341-34-8 | 2A-9030788 |
| 4-Amino-4H-1,2,4-triazole-3-thiol | 4343-75-3 | 2A-9030792 |
| 2-Bromomethyl-1,3-dioxolane | 4360-63-8 | 2A-9030811 |
| 4-Quinolinecarboxaldehyde | 4363-93-3 | 2A-9030812 |
| 4-[2-(Dimethylamino)ethyl]morpholine | 4385-05-1 | 2A-9030825 |
| 4-Cyanopiperidine | 4395-98-6 | 2A-9030843 |
| Octahydropyrido[1,2-a]pyrazine | 4430-75-5 | 2A-9030887 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA