| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4346-94-5 |
| Catalog No. | 2A-9030797 |
| Chinese Name | 氨基硫脲盐酸盐 |
| Synonyms | MFCD00060206; ThioseMicarbazide Hydrochloride |
| Molecular Formula | C1H6N3Cl1S1 |
| Molecular Weight | 127.6 |
| Purity | 98.00 |
| Density | 1.376g/cm3 |
| Boiling Point | 227 °C (35 mmHg) |
| Melting Point | 58-60 °C(lit.) |
| Appearance | Solid;White to Almost white powder to crystal |
| Water Solubility | Water solubility: soluble |
| Storage Condition | Store at room temperature, away from light, in a v |
| Packaging | III |
| HTC | 2930909090 |
| MDL Number | MFCD00060206 |
| SMILES | Cl.NNC(N)=S |
| InChI | InChI=1S/CH5N3S.ClH/c2-1(5)4-3;/h3H2,(H3,2,4,5);1H |
| InChI Key | LEHOGBUBQSGCOK-UHFFFAOYSA-N |
| MSDS | msds/30797_1_4346_94_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Item 1 Poisons. UN number: 2811 Proper Shipping Name: Toxic Solid, Organic, Not Otherwise Specified Packing grade: III |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 5-Hydroxyvaleraldehyde | 4221-03-8 | 2A-9030673 |
| (4-Chlorophenyl)acetaldehyde | 4251-65-4 | 2A-9030697 |
| 4-Methylcyclohexanecarboxylic acid | 4331-54-8 | 2A-9030779 |
| 3-Ethoxycarbonylphenylboronic acid | 4334-87-6 | 2A-9030782 |
| Tributyltin benzoate | 4342-36-3 | 2A-9030791 |
| 2-Formylthiophene-3-boronic acid | 4347-31-3 | 2A-9030798 |
| 3-Formyl-4-thiopheneboronic acid | 4347-32-4 | 2A-9030799 |
| 5-Formyl-2-thiopheneboronic acid | 4347-33-5 | 2A-9030800 |
| 4-Iodomethyl-2,2-dimethyl-1,3-dioxalane | 4351-11-5 | 2A-9030803 |
| 1,3,5-Benzenetricarboxylic acid chloride | 4422-95-1 | 2A-9030872 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS