
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4295-06-1 |
| Catalog No. | 2A-9030739 |
| Chinese Name | 4-氯-2-甲基喹啉 |
| Synonyms | 4-Chloro-2-methylquinoline; T66 BNJ C1 EG; EINECS 224-300-8; MFCD00006757; 4-Chloroquinaldine |
| Molecular Formula | C10H8ClN |
| Molecular Weight | 237.68 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 269.5±0.0 °C at 760 mmHg |
| Melting Point | 39 °C |
| Appearance | solid |
| Storage Condition | Keep away from light, in a ventilated and dry plac |
| HTC | 2933499090 |
| PubChem ID | 329775855 |
| MDL Number | MFCD06668102 |
| SMILES | ClC1=NC2=C(OC)C=CC(OC)=C2C(C)=C1 |
| InChI | 1S/C12H12ClNO2/c1-7-6-10(13)14-12-9(16-3)5-4-8(15-2)11(7)12/h4-6H,1-3H3 |
| InChI Key | SVTDGXZOUFALGO-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/30739_1_4295_06_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| Methyl 1H-Pyrrole-1-carboxylate | 4277-63-8 | 2A-9030724 |
| Dimethyl furan-2,5-dicarboxylate | 4282-32-0 | 2A-9030726 |
| 2-(4-Nitrophenyl)pyridine | 4282-47-7 | 2A-9030729 |
| 4-(3-Nitrophenyl)pyridine | 4282-48-8 | 2A-9030730 |
| 4-Chloro-6-methoxyquinoline | 4295-04-9 | 2A-9030738 |
| 4-Cyanotetrahydropyran | 4295-99-2 | 2A-9030741 |
| 2-Ethynylthiophene | 4298-52-6 | 2A-9030743 |
| 1-Butylimidazole | 4316-42-1 | 2A-9030754 |
| 4,6-Dichloro-5-nitropyrimidine | 4316-93-2 | 2A-9030761 |
| 4,6-Dichloro-5-methylpyrimidine | 4316-97-6 | 2A-9030762 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA