CAS Number4273-92-1
SynonymsNaphtazol LC; 3-Hydroxy-[2]naphthoesaeure-(4-chlor-2,5-dimethoxy-anilid); Naphtol AS-LC; C.I. Azoic Coupling Component 23; Naphthol AS-LC; 3-Oxy-naphthoesaeure-(2)-(4-chlor-2.5-dimethoxy-anilid); Naphtol AS-LCLL; naphthol-AS-LC; Naphtanilide LC; 3-hydroxy-[2]naphthoic acid-(4-chloro-2,5-dimethoxy-anilide); Sanatol LC; N-(4-Chloro-2,5-dimethoxyphenyl)-3-hydroxy-2-naphthamide; 4'-chloro-3-hydroxy-2',5'-dimethoxy-2-naphthanilide; N-(4-chloro-2,5-dimethoxyphenyl)-3-hydroxy-2-naphthalenecarboxamide; EINECS 224-270-6
Molecular FormulaC19H16ClNO4
Molecular Weight357.797
Purity98.00%
Density1.371 g/cm3
Boiling Point479.8ºC
Melting Point190ºC
Appearanceoff-white powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4273-92-1 |
| Catalog No. | 2A-0202369 |
| Chinese Name | N-(4-氯-2,5-二甲氧苯基)-3-羟基-2-萘酰胺 |
| Synonyms | Naphtazol LC; 3-Hydroxy-[2]naphthoesaeure-(4-chlor-2,5-dimethoxy-anilid); Naphtol AS-LC; C.I. Azoic Coupling Component 23; Naphthol AS-LC; 3-Oxy-naphthoesaeure-(2)-(4-chlor-2.5-dimethoxy-anilid); Naphtol AS-LCLL; naphthol-AS-LC; Naphtanilide LC; 3-hydroxy-[2]naphthoic acid-(4-chloro-2,5-dimethoxy-anilide); Sanatol LC; N-(4-Chloro-2,5-dimethoxyphenyl)-3-hydroxy-2-naphthamide; 4'-chloro-3-hydroxy-2',5'-dimethoxy-2-naphthanilide; N-(4-chloro-2,5-dimethoxyphenyl)-3-hydroxy-2-naphthalenecarboxamide; EINECS 224-270-6 |
| Molecular Formula | C19H16ClNO4 |
| Molecular Weight | 357.797 |
| Purity | 98.00 |
| Density | 1.371 g/cm3 |
| Boiling Point | 479.8ºC |
| Melting Point | 190ºC |
| Appearance | off-white powder |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2924299090 |
| MDL Number | MFCD00043903 |
| SMILES | COc1cc(NC(=O)c2cc3ccccc3cc2O)c(OC)cc1Cl |
| InChI Key | QIHKTBRNOLQDGQ-UHFFFAOYSA-N |
| MSDS | msds/30720_1_4273_92_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Dimethylamino-2-methylpropyl chloride hydrochloride | 4261-67-0 | 2A-9030704 |
| 2-Diisopropylaminoethyl chloride hydrochloride | 4261-68-1 | 2A-9030705 |
| 2-Pyridinyl sulfide | 4262-06-0 | 2A-9030706 |
| Disodium 4-nitrophenylphosphate | 4264-83-9 | 2A-9030709 |
| 5-(Dimethylamino)-1-naphthalenesulfonic acid | 4272-77-9 | 2A-9030719 |
| 2-(Phenylsulfonyl)aniline | 4273-98-7 | 2A-9030721 |
| 1-Bromoicosane | 4276-49-7 | 2A-9030723 |
| 1-Iodoheptane | 4282-40-0 | 2A-9030727 |
| 1-Iodononane | 4282-42-2 | 2A-9030728 |
| 6-Bromo-1-hexanol | 4286-55-9 | 2A-9030731 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS