
CAS Number4209-24-9
Synonymsp-methylphenacyl chloride; Chloromethyl p-tolyl ketone; MFCD00972094; 1-chloro-2-(4-tolyl)ethan-2-one; 4-(2-Chloroacetyl)toluene; 4-methylphenyl chloromethyl ketone; 2-chloro-1-p-tolyl-ethanone; 4-methylphenacyl chloride
Molecular FormulaC9H9O1Cl1
Molecular Weight168.62
Purity98.00%
Density1.134 g/cm3
Boiling Point258.5ºC at 760 mmHg
Melting Point57.5°C (lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4209-24-9 |
| Catalog No. | 2A-9030662 |
| Chinese Name | 对甲基-2-氯乙酰苯 |
| Synonyms | p-methylphenacyl chloride; Chloromethyl p-tolyl ketone; MFCD00972094; 1-chloro-2-(4-tolyl)ethan-2-one; 4-(2-Chloroacetyl)toluene; 4-methylphenyl chloromethyl ketone; 2-chloro-1-p-tolyl-ethanone; 4-methylphenacyl chloride |
| Molecular Formula | C9H9O1Cl1 |
| Molecular Weight | 168.62 |
| Purity | 98.00 |
| Density | 1.134 g/cm3 |
| Boiling Point | 258.5ºC at 760 mmHg |
| Melting Point | 57.5°C (lit.) |
| Storage Condition | room temperature |
| HTC | 2914700090 |
| MDL Number | MFCD00972094 |
| SMILES | Cc1ccc(C(=O)CCl)cc1 |
| InChI | InChI=1S/C9H9ClO/c1-7-2-4-8(5-3-7)9(11)6-10/h2-5H,6H2,1H3 |
| InChI Key | HGLJRZYKFVJSEE-UHFFFAOYSA-N |
| MSDS | msds/30662_1_4209_24_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| Butanedihydrazide | 4146-43-4 | 2A-9030603 |
| 4,4'-Biphenyldiboronic acid | 4151-80-8 | 2A-9030607 |
| Crotonaldehyde | 4170-30-3 | 2A-9030620 |
| 4-(N,N-Diphenylamino)benzaldehyde | 4181-05-9 | 2A-9030634 |
| (Iodomethyl)trimethylsilane | 4206-67-1 | 2A-9030659 |
| 5-Hydroxyvaleraldehyde | 4221-03-8 | 2A-9030673 |
| (4-Chlorophenyl)acetaldehyde | 4251-65-4 | 2A-9030697 |
| 4-Methylcyclohexanecarboxylic acid | 4331-54-8 | 2A-9030779 |
| 3-Ethoxycarbonylphenylboronic acid | 4334-87-6 | 2A-9030782 |
| Tributyltin benzoate | 4342-36-3 | 2A-9030791 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA