
CAS Number4025-64-3
Synonyms3-(Chlorosulfonyl)benzoic acid; MFCD00024877; EINECS 223-692-8; 3-chlorosulfonylbenzoic acid
Molecular FormulaClSO2C6H4CO2H
Molecular Weight220.63
Purity95%
Density1.6±0.1 g/cm3
Boiling Point402.5±28.0 °C at 760 mmHg
Melting Point128-130 °C (lit.)
Appearancewhite powder
EINECS223-692-8
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4025-64-3 |
| Catalog No. | 2A-9030479 |
| Chinese Name | 间氯磺酰基苯甲酸 |
| Synonyms | 3-(Chlorosulfonyl)benzoic acid; MFCD00024877; EINECS 223-692-8; 3-chlorosulfonylbenzoic acid |
| Molecular Formula | ClSO2C6H4CO2H |
| Molecular Weight | 220.63 |
| Purity | 95 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 402.5±28.0 °C at 760 mmHg |
| Melting Point | 128-130 °C (lit.) |
| Appearance | white powder |
| Water Solubility | Soluble in: methanol |
| Storage Condition | Keep away from light, in a ventilated and dry plac |
| Packaging | II |
| EINECS | 223-692-8 |
| HTC | 2916399090 |
| PubChem ID | 24867699 |
| MDL Number | MFCD00024877 |
| SMILES | OC(=O)c1cccc(c1)S(Cl)(=O)=O |
| InChI | 1S/C7H5ClO4S/c8-13(11,12)6-3-1-2-5(4-6)7(9)10/h1-4H,(H,9,10) |
| InChI Key | LMRKXSDOAFUINK-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | 8 |
| MSDS | msds/30479_1_4025_64_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-(5H-Purin-6-yl)benzamide | 4005-49-6 | 2A-9030463 |
| N,N'-Diisopropylethylenediamine | 4013-94-9 | 2A-9030469 |
| Diphenylmethoxyphosphine | 4020-99-9 | 2A-9030471 |
| 2-Methylisonicotinic acid | 4021-11-8 | 2A-9030474 |
| trans-Aconitic acid | 4023-65-8 | 2A-9030478 |
| 1,2,3,4-Di-O-isopropylidene-alpha-D-fucopyranose | 4026-27-1 | 2A-9030481 |
| Allylchlorodimethylsilane | 4028-23-3 | 2A-9030483 |
| 2,4,6-Trimethyliodobenzene | 4028-63-1 | 2A-9030484 |
| L-2,3-Diaminopropionic acid | 4033-39-0 | 2A-9030485 |
| N-Acetyl-L-asparagine | 4033-40-3 | 2A-9030486 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA