
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3877-86-9 |
| Catalog No. | 2A-9030260 |
| Chinese Name | 葫芦素D |
| Synonyms | Elatericine A; Elatericin A; Cucurbitacin D |
| Molecular Formula | C30H44O7 |
| Molecular Weight | 516.67 |
| Purity | ≥98.0 (HPLC) |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 684.0±55.0 °C at 760 mmHg |
| Melting Point | 151-152ºC |
| Storage Condition | The warehouse is low-temperature, ventilated, dry, |
| Application | Cucurbitacin D, an active ingredient in pumpkin, can disrupt the interaction between Hsp90 and two auxiliary molecular chaperones, Cdc37 and p23, preventing the maturation of Hsp90 client proteins (He |
| HTC | 29144000 |
| MDL Number | MFCD28963759 |
| SMILES | O[C@H]1[C@@H]([C@@]2([C@]([C@H]3[C@]([C@@H]4C[C@@H](C(=O)C(C4=CC3)(C)C)O)(C(=O)C2)C)(C1)C)C)[C@](O)(C)C(=O)\C=C\C(O)(C)C |
| InChI | 1S/C30H44O7/c1-25(2,36)12-11-21(33)30(8,37)23-19(32)14-27(5)20-10-9-16-17(13-18(31)24(35)26(16,3)4)29(20,7)22(34)15-28(23,27)6/h9,11-12,17-20,23,31-32,36-37H,10,13-15H2,1-8H3/b12-11+/t17-,18+,19-,20+,23+,27+,28-,29+,30+/m1/s1 |
| InChI Key | SRPHMISUTWFFKJ-QJNWWGCFSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/30260_1_3877_86_9.pdf |
| Transport Info | Product Name: Cucurbitacin D |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Chloroprocaine hydrochloride | 3858-89-7 | 2A-9030245 |
| 1,3-Cyclopentanedione | 3859-41-4 | 2A-9030246 |
| Ioxynil octanoate | 3861-47-0 | 2A-9030247 |
| 7-Hydroxy-4-cholesten-3-one | 3862-25-7 | 2A-9030249 |
| Methyl n-propyl sulfide | 3877-15-4 | 2A-9030259 |
| 4-Ethoxy-6-methyl-1,3,5-triazin-2-amine | 3882-66-4 | 2A-9030264 |
| 2-Amino-2-thiazoline hydrochloride | 3882-98-2 | 2A-9030265 |
| 3-(Acetyloxy)-2-methyl-2-cyclopenten-1-one | 3883-57-6 | 2A-9030266 |
| N-Hydroxyethylphthalimide | 3891-07-4 | 2A-9030271 |
| 1,4-Bis(vinyloxy)-butane | 3891-33-6 | 2A-9030272 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA