
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3827-49-4 |
| Catalog No. | 2A-9030220 |
| Chinese Name | 2-氯-5-氟苯酚 |
| Synonyms | 2-Chloro-5-fluorophenol; MFCD00042524 |
| Molecular Formula | C6H4O1Cl1F1 |
| Molecular Weight | 146.55 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 189.3±20.0 °C at 760 mmHg |
| Appearance | Transparent colorless to light yellow liquid |
| Water Solubility | slightly soluble |
| Storage Condition | Keep away from light, in a ventilated and dry plac |
| HTC | 2908199090 |
| MDL Number | MFCD00042524 |
| SMILES | Oc1cc(F)ccc1Cl |
| InChI | InChI=1S/C6H4ClFO/c7-5-2-1-4(8)3-6(5)9/h1-3,9H |
| InChI Key | CMQOZIKIOASEIN-UHFFFAOYSA-N |
| MSDS | msds/30220_1_3827_49_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Scandium acetate | 3804-23-7 | 2A-9030205 |
| Columbianetin | 3804-70-4 | 2A-9030206 |
| 1-Bromo-2-ethylbutane | 3814-34-4 | 2A-9030216 |
| Methyl 2-amino-5-nitrobenzoate | 3816-62-4 | 2A-9030218 |
| 1-Fluoro-3-iodo-5-nitrobenzene | 3819-88-3 | 2A-9030219 |
| 1,10-Phenanthroline monohydrochloride monohydrate | 3829-86-5 | 2A-9030223 |
| Norethisterone enanthate | 3836-23-5 | 2A-9030225 |
| 2,5-Dimethoxybenzyl chloride | 3840-27-5 | 2A-9030227 |
| 3,4,5-Trimethoxybenzyl chloride | 3840-30-0 | 2A-9030228 |
| 3,4,5-Trimethoxybenzyl alcohol | 3840-31-1 | 2A-9030229 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA