
CAS Number3769-41-3
SynonymsBenzyl 3-hydroxyphenyl ether; 3-Benzyloxyphenol, Pract.; 3-(Benzyloxy)phenol; 3-phenylmethoxyphenol; Resorcinol Monobenzyl Ether
Molecular FormulaC13H12O2
Molecular Weight200.233
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point358.0±17.0 °C at 760 mmHg
Melting Point50ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3769-41-3 |
| Catalog No. | 2A-9030172 |
| Chinese Name | 3-苄氧基苯酚 |
| Synonyms | Benzyl 3-hydroxyphenyl ether; 3-Benzyloxyphenol, Pract.; 3-(Benzyloxy)phenol; 3-phenylmethoxyphenol; Resorcinol Monobenzyl Ether |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.233 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 358.0±17.0 °C at 760 mmHg |
| Melting Point | 50ºC |
| Storage Condition | Keep away from light, in a ventilated and dry plac |
| HTC | 2909500000 |
| SMILES | Oc1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C13H12O2/c14-12-7-4-8-13(9-12)15-10-11-5-2-1-3-6-11/h1-9,14H,10H2 |
| InChI Key | FOTVZLOJAIEAOY-UHFFFAOYSA-N |
| MSDS | msds/30172_1_3769_41_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 95.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Cyanophenylacetonitrile | 3759-28-2 | 2A-9030162 |
| Furaltadone hydrochloride | 3759-92-0 | 2A-9030163 |
| Pyrrolidin-3-one hydrochloride | 3760-52-9 | 2A-9030164 |
| Trestolone | 3764-87-2 | 2A-9030167 |
| Bis(dimethylamino)dimethylsilane | 3768-58-9 | 2A-9030171 |
| 1,3-Dibenzyloxybenzene | 3769-42-4 | 2A-9030173 |
| 2-Methyl-4-thiocyanatophenol | 3774-53-6 | 2A-9030177 |
| Lauroyliminodiacetic acid | 3775-51-7 | 2A-9030178 |
| 2-(tert-Butylamino)ethyl methacrylate | 3775-90-4 | 2A-9030180 |
| Todralazine hydrochloride | 3778-76-5 | 2A-9030184 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA