
CAS Number3755-83-7
Synonyms2-METHYL-4,5-DIPHENYL-THIAZOLE; EINECS 223-161-0; MFCD00186396; 2-Methyl-4,5-diphenylthiazole; 2-methyl-4,5-diphenyl-1,3-thiazole
Molecular FormulaC16H13NS
Molecular Weight251.35
Purity98.00%
Density1.147 g/cm3
Boiling Point370.2ºC at 760 mmHg
Melting Point44-50 °C (lit.)
Appearancesolid
EINECS223-161-0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3755-83-7 |
| Catalog No. | 2A-9030160 |
| Chinese Name | 2-甲基-4,5-二苯基噻唑 |
| Synonyms | 2-METHYL-4,5-DIPHENYL-THIAZOLE; EINECS 223-161-0; MFCD00186396; 2-Methyl-4,5-diphenylthiazole; 2-methyl-4,5-diphenyl-1,3-thiazole |
| Molecular Formula | C16H13NS |
| Molecular Weight | 251.35 |
| Purity | 98.00 |
| Density | 1.147 g/cm3 |
| Boiling Point | 370.2ºC at 760 mmHg |
| Melting Point | 44-50 °C (lit.) |
| Appearance | solid |
| Water Solubility | Soluble in: methanol |
| Storage Condition | Keep away from light, in a ventilated and dry plac |
| EINECS | 223-161-0 |
| HTC | 2934100090 |
| PubChem ID | 24878131 |
| MDL Number | MFCD00186396 |
| SMILES | Cc1nc(-c2ccccc2)c(s1)-c3ccccc3 |
| InChI | 1S/C16H13NS/c1-12-17-15(13-8-4-2-5-9-13)16(18-12)14-10-6-3-7-11-14/h2-11H,1H3 |
| InChI Key | ZFYWCVZNRMSXBT-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/30160_1_3755_83_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 2-Methyl-4,5-diphenylthiazole Modification number: 5 |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 3-(Aminomethyl)pyridine | 3731-52-0 | 2A-9030130 |
| 3,3,4,4-Tetrachlorotetrahydrothiophene 1,1-dioxide | 3737-41-5 | 2A-9030140 |
| 2,6-Pyridinedicarboxylic acid chloride | 3739-94-4 | 2A-9030145 |
| N-Benzothiazol-2-ylsulfanyl-N-tert-butyl-benzothiazole-2-sulfenamide | 3741-80-8 | 2A-9030150 |
| 2-(Chloromethyl)quinoline hydrochloride | 3747-74-8 | 2A-9030155 |
| 2-Pentylfuran | 3777-69-3 | 2A-9030181 |
| 2-Heptylfuran | 3777-71-7 | 2A-9030182 |
| 9-Methoxy-2,3-dihydro-7H-furo[3,2-g]chromen-7-one | 3779-03-1 | 2A-9030185 |
| 1-(3-Fluorophenyl)piperazine | 3801-89-6 | 2A-9030203 |
| 2-Pyridinethiol-1-oxide sodium salt | 3811-73-2 | 2A-9030212 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA