
CAS Number3736-81-0
SynonymsAmebiazol; Miforon; MFCD00083302; Diclofurazol; Diloxanid furoate; Furamide (amebicide); Entamide furoate; Furentomin; Entamide 2-furoate; Histomibal; DILOXANIDE FUROATE; EINECS 223-108-1
Molecular FormulaC14H11Cl2NO4
Molecular Weight328.14700
Purity98.00%
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3736-81-0 |
| Catalog No. | 2A-9030138 |
| Chinese Name | 糠酸二氯尼特 |
| Synonyms | Amebiazol; Miforon; MFCD00083302; Diclofurazol; Diloxanid furoate; Furamide (amebicide); Entamide furoate; Furentomin; Entamide 2-furoate; Histomibal; DILOXANIDE FUROATE; EINECS 223-108-1 |
| Molecular Formula | C14H11Cl2NO4 |
| Molecular Weight | 328.14700 |
| Purity | 98.00 |
| Storage Condition | 2-8℃ |
| Application | Diloxanide furoate is a luminal antiamoebic drug used in the treatment of amebiasis and is considered the first choice for the treatment of mild intestinal amebiasis or asymptomatic cyst carriers. |
| SMILES | CN(C(=O)C(Cl)Cl)c1ccc(OC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C14H11Cl2NO4/c1-17(13(18)12(15)16)9-4-6-10(7-5-9)21-14(19)11-3-2-8-20-11/h2-8,12H,1H3 |
| InChI Key | BDYYDXJSHYEDGB-UHFFFAOYSA-N |
| Transport Info | Product name: Furanamide |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Crotonic acid | 3724-65-0 | 2A-9030125 |
| 1-Morpholinocyclododecene | 3725-39-1 | 2A-9030126 |
| Quinuclidin-3-one | 3731-38-2 | 2A-9030128 |
| 2-Picolylamine | 3731-51-9 | 2A-9030129 |
| Tropine benzilate | 3736-36-5 | 2A-9030136 |
| 1-Chloro-3-bromo-1-propene | 3737-00-6 | 2A-9030139 |
| 2-Hydroxy-2-methylbutyric acid | 3739-30-8 | 2A-9030142 |
| Glycol sulfite | 3741-38-6 | 2A-9030148 |
| 2,4,6-Tribromophenyl acrylate | 3741-77-3 | 2A-9030149 |
| 4-Ethylcyclohexene | 3742-42-5 | 2A-9030151 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA