
CAS Number3651-62-5
SynonymsNaphthol AS-RT; C.I. Azoic Coupling Component 31; 2-Naphthol-3-carboxylic acid p-toluidide; p-tolylamide of 3-hydroxy-2-naphthoic acid; Cibanaphthol RT; Azotol PT; Acna Naphthol PT; Naphtoelan RT; 2-Naphtho-p-toluidide,3-hydroxy; Naphtazol T
Molecular FormulaC16H15NO2
Molecular Weight253.303
Purity98.00%
Density1.277 g/cm3
Boiling Point404.9ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3651-62-5 |
| Catalog No. | 2A-9030043 |
| Chinese Name | 3-羟基-N-(4-甲基苯基)-2-萘甲酰胺 |
| Synonyms | Naphthol AS-RT; C.I. Azoic Coupling Component 31; 2-Naphthol-3-carboxylic acid p-toluidide; p-tolylamide of 3-hydroxy-2-naphthoic acid; Cibanaphthol RT; Azotol PT; Acna Naphthol PT; Naphtoelan RT; 2-Naphtho-p-toluidide,3-hydroxy; Naphtazol T |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.303 |
| Purity | 98.00 |
| Density | 1.277 g/cm3 |
| Boiling Point | 404.9ºC at 760 mmHg |
| HTC | 2924299090 |
| MDL Number | MFCD02673571 |
| SMILES | Cc1ccc(NC(=O)c2cc3ccccc3cc2O)cc1 |
| InChI | InChI=1S/C18H15NO2/c1-12-6-8-15(9-7-12)19-18(21)16-10-13-4-2-3-5-14(13)11-17(16)20/h2-11,20H,1H3,(H,19,21) |
| InChI Key | NBBZFRCZVJXXHT-UHFFFAOYSA-N |
| MSDS | msds/30043_1_3651_62_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Nitroethylene | 3638-64-0 | 2A-9030027 |
| D-Glucosamic acid | 3646-68-2 | 2A-9030037 |
| 5-Norbonene-2,3-dicarboximide | 3647-74-3 | 2A-9030039 |
| Bis(lauroyloxy)dioctyltin | 3648-18-8 | 2A-9030040 |
| Diundecyl phthalate | 3648-20-2 | 2A-9030041 |
| 5-(Pyridin-4-yl)-4H-1,2,4-triazol-3-amine | 3652-17-3 | 2A-9030044 |
| Chloroethane-1,1-D2 | 3652-86-6 | 2A-9030045 |
| 1,5-Bis-(4-hydroxyphenyl)-1,4-pentadien-3-one | 3654-49-7 | 2A-9030047 |
| Disodium lauriminodipropionate | 3655-00-3 | 2A-9030048 |
| Dimethyl trisulfide | 3658-80-8 | 2A-9030050 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA