
CAS Number3598-16-1
SynonymsNatriumphenoxyacetat; Phenoxyacetic acid sodium salt; MFCD00064234; Phenoxy acetic acid sodium; Sodium phenoxyacetate; EINECS 222-746-8; Acetic acid, 2-phenoxy-, sodium salt (1:1)
Molecular FormulaC8H7NaO3
Molecular Weight174.133
Purity98.00%
Boiling Point285ºC at 760mmHg
Melting Point262-264ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3598-16-1 |
| Catalog No. | 2A-9029972 |
| Chinese Name | 苯氧乙酸钠 |
| Synonyms | Natriumphenoxyacetat; Phenoxyacetic acid sodium salt; MFCD00064234; Phenoxy acetic acid sodium; Sodium phenoxyacetate; EINECS 222-746-8; Acetic acid, 2-phenoxy-, sodium salt (1:1) |
| Molecular Formula | C8H7NaO3 |
| Molecular Weight | 174.133 |
| Purity | 98.00 |
| Boiling Point | 285ºC at 760mmHg |
| Melting Point | 262-264ºC |
| Storage Condition | Keep away from light, in a ventilated and dry plac |
| HTC | 2918990090 |
| MDL Number | MFCD00064234 |
| SMILES | O=C([O-])COc1ccccc1.[Na+] |
| InChI | InChI=1S/C8H8O3.Na/c9-8(10)6-11-7-4-2-1-3-5-7;/h1-5H,6H2,(H,9,10);/q;+1/p-1 |
| InChI Key | WPTJBFNYRRZIDZ-UHFFFAOYSA-M |
| MSDS | msds/29972_1_3598_16_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards Sodium Phenoxyacetate Modification Number: 5 Module 14. Shipping information UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6-Methoxyharmalan | 3589-73-9 | 2A-9029964 |
| Tetraoctyltin | 3590-84-9 | 2A-9029965 |
| 2,2-Dichloro-1-methylcyclopropylbenzene | 3591-42-2 | 2A-9029966 |
| Methandriol dipropionate | 3593-85-9 | 2A-9029969 |
| 2-(4-Chlorophenoxy)acetonitrile | 3598-13-8 | 2A-9029971 |
| 3,4,5-Trithiaheptane | 3600-24-6 | 2A-9029974 |
| 1-Chloro-3,5-di(4-chlorbenzoyl)-2-deoxy-D-ribose | 3601-90-9 | 2A-9029979 |
| 2-tert-Butyl-1,4-benzoquinone | 3602-55-9 | 2A-9029980 |
| Methyl 4-acetylbenzoate | 3609-53-8 | 2A-9029983 |
| 6-Methoxytryptamine | 3610-36-4 | 2A-9029984 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA