
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3537-14-2 |
| Catalog No. | 2A-9029917 |
| Chinese Name | 5-硝基吡啶-2,3-二胺 |
| Synonyms | 2,3-diamino-5-nitropyridine; 5-nitro-2,3-pyridinediamine; 5-Nitropyridine-2,3-diamine; 5-nitro-pyridine-2,3-diamine |
| Molecular Formula | C5H6N4O2 |
| Molecular Weight | 202.05 |
| Purity | 98.00 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 476.1±40.0 °C at 760 mmHg |
| Storage Condition | Room temperature, protected from light, dry and se |
| HTC | 2933399090 |
| PubChem ID | 407163 |
| SMILES | Nc1cc([N+](=O)[O-])cnc1N |
| InChI | InChI=1S/C5H6N4O2/c6-4-1-3(9(10)11)2-8-5(4)7/h1-2H,6H2,(H2,7,8) |
| InChI Key | JOQJNCSAEMIZOU-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-Chloro-2,6-dimethylpyridine | 3512-75-2 | 2A-9029889 |
| 6-Methoxyindazole | 3522-07-4 | 2A-9029903 |
| 4-Hydroxy-6-methylpyrimidine | 3524-87-6 | 2A-9029908 |
| 1-(3-Aminopropyl)piperidine | 3529-08-6 | 2A-9029909 |
| 1H-INDOLE-3-CARBOXAMIDINE | 764600-87-5 | 2A-9029916 |
| 1-Benzothiophene-2-carbaldehyde | 3541-37-5 | 2A-9029919 |
| 3-Amino-5-hydroxypyridine | 3543-01-9 | 2A-9029921 |
| 1-Methyl-5-nitro-1H-benzimidazole-2-butanoic acid ethyl ester | 3543-72-4 | 2A-9029922 |
| 1-Methyl-5-amino-1H-benzimidazole-2-butanoic acid ethyl ester | 3543-73-5 | 2A-9029923 |
| 5-[Bis(2-hydroxyethyl)amino]-1-methyl-1H-benzimidazole-2-butanoic acid ethyl ester | 3543-74-6 | 2A-9029924 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA