
CAS Number3507-26-4
SynonymsMFCD04448821; 2-Chloro-6-methyl-1,3-benzothiazole; 2-Chloro-6-methylbenzo[d]thiazole; 6-Methyl-2-chloro benzothiazole
Molecular FormulaC8H6ClNS
Molecular Weight183.658
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point268.4±9.0 °C at 760 mmHg
Melting Point44-49ºC
AppearanceSolid;White to Almost white powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3507-26-4 |
| Catalog No. | 2A-9029883 |
| Chinese Name | 2-氯-6-甲基苯并噻唑 |
| Synonyms | MFCD04448821; 2-Chloro-6-methyl-1,3-benzothiazole; 2-Chloro-6-methylbenzo[d]thiazole; 6-Methyl-2-chloro benzothiazole |
| Molecular Formula | C8H6ClNS |
| Molecular Weight | 183.658 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 268.4±9.0 °C at 760 mmHg |
| Melting Point | 44-49ºC |
| Appearance | Solid;White to Almost white powder to crystal |
| Water Solubility | Soluble in: methanol |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2934999090 |
| PubChem ID | 3203591 |
| SMILES | Cc1ccc2nc(Cl)sc2c1 |
| InChI | InChI=1S/C8H6ClNS/c1-5-2-3-6-7(4-5)11-8(9)10-6/h2-4H,1H3 |
| InChI Key | PAKSGYIFUVNJQF-UHFFFAOYSA-N |
| MSDS | msds/29883_1_3507_26_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-Methyl-2-phenylpyridine | 3475-21-6 | 2A-9029857 |
| 2-Methyl-4-nitro-1H-indole | 3484-10-4 | 2A-9029868 |
| 2-Ethyl-1H-indole | 3484-18-2 | 2A-9029869 |
| 5-Nitro-2,3,3-trimethylindolenine | 3484-22-8 | 2A-9029870 |
| 2-Bromo-6-chlorobenzothiazole | 3507-17-3 | 2A-9029882 |
| 2-Chloro-4-methoxybenzothiazole | 3507-27-5 | 2A-9029884 |
| 2-Chloro-5-methoxybenzothiazole | 3507-28-6 | 2A-9029885 |
| 4-Chloro-2,6-dimethylpyridine | 3512-75-2 | 2A-9029889 |
| 6-Methoxyindazole | 3522-07-4 | 2A-9029903 |
| 4-Hydroxy-6-methylpyrimidine | 3524-87-6 | 2A-9029908 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA