CAS Number3487-99-8
SynonymsCinnamic acid,pentyl ester; Amylcinnamat; 3-Methylbutyl (2E)-3-phenylacrylate; Pentylcinnamat; amyl cinnamate; pentylcinnamate; Einecs 222-478-1; N-AMYL CINNAMATE; MFCD00027273; 3-methylbutyl (2E)-3-phenylprop-2-enoate
Molecular FormulaC14H18O2
Molecular Weight218.292
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point313.2±11.0 °C at 760 mmHg
AppearanceColorless to light yellow transparent liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3487-99-8 |
| Catalog No. | 2A-9029875 |
| Chinese Name | 肉桂酸戊酯 |
| Synonyms | Cinnamic acid,pentyl ester; Amylcinnamat; 3-Methylbutyl (2E)-3-phenylacrylate; Pentylcinnamat; amyl cinnamate; pentylcinnamate; Einecs 222-478-1; N-AMYL CINNAMATE; MFCD00027273; 3-methylbutyl (2E)-3-phenylprop-2-enoate |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.292 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 313.2±11.0 °C at 760 mmHg |
| Appearance | Colorless to light yellow transparent liquid |
| Storage Condition | Storage, transportation and storage: It is flammab |
| HTC | 2916399090 |
| PubChem ID | 6221249 |
| SMILES | CCCCCOC(=O)\C=C\c1ccccc1 |
| InChI | InChI=1S/C14H18O2/c1-2-3-7-12-16-14(15)11-10-13-8-5-4-6-9-13/h4-6,8-11H,2-3,7,12H2,1H3/b11-10+ |
| InChI Key | InChIKey=QDRJCWZGTMRXCL-ZHACJKMWSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethylguanidinium sulphate | 3482-86-8 | 2A-9029864 |
| Lithium acetoacetate | 3483-11-2 | 2A-9029865 |
| DL-1,4-Dithiothreitol | 3483-12-3 | 2A-9029866 |
| Ethyl N-benzoyl-L-tyrosinate | 3483-82-7 | 2A-9029867 |
| Clidinium bromide | 3485-62-9 | 2A-9029871 |
| 1,9-Nonanedithiol | 3489-28-9 | 2A-9029876 |
| N-Methylhomoveratrylamine | 3490-06-0 | 2A-9029877 |
| 1,4-Bis(4-aminophenoxy)benzene | 3491-12-1 | 2A-9029878 |
| Cesium formate | 3495-36-1 | 2A-9029879 |
| Carbinoxamine maleate | 3505-38-2 | 2A-9029880 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS