CAS Number3401-80-7
Synonyms3,6-DICHLOROSALICYLIC ACID; 2-Hydroxy-3,6-dichlorobenzoic acid; 3,6-Dichlor-2-hydroxy-benzoesaeure; 2-hydroxy-3,5-dichlorobenzoic acid; Benzoic acid,3,6-dichloro-2-hydroxy; EINECS 222-275-8; MFCD00155381; 3,6-Dichloro-2-hydroxy-benzoic acid; Salicylic acid,3,6-dichloro; 2-Oxy-3,6-dichlorobenzoic acid
Molecular FormulaC7H4Cl2O3
Molecular Weight212.97
Purity98 (CP)%
Density1.665 g/cm3
Boiling Point306.7ºC at 760 mmHg
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3401-80-7 |
| Catalog No. | 2A-9029763 |
| Chinese Name | 3,6-二氯-2-羟基苯甲酸 |
| Synonyms | 3,6-DICHLOROSALICYLIC ACID; 2-Hydroxy-3,6-dichlorobenzoic acid; 3,6-Dichlor-2-hydroxy-benzoesaeure; 2-hydroxy-3,5-dichlorobenzoic acid; Benzoic acid,3,6-dichloro-2-hydroxy; EINECS 222-275-8; MFCD00155381; 3,6-Dichloro-2-hydroxy-benzoic acid; Salicylic acid,3,6-dichloro; 2-Oxy-3,6-dichlorobenzoic acid |
| Molecular Formula | C7H4Cl2O3 |
| Molecular Weight | 212.97 |
| Purity | 98 (CP) |
| Density | 1.665 g/cm3 |
| Boiling Point | 306.7ºC at 760 mmHg |
| Appearance | powder |
| Storage Condition | room temperature, dry |
| HTC | 2918290000 |
| PubChem ID | 329762589 |
| MDL Number | MFCD11656124 |
| SMILES | OC(=O)[13c]1[13c](Cl)[13cH][13cH][13c](Cl)[13c]1O |
| InChI | 1S/C7H4Cl2O3/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2,10H,(H,11,12)/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChI Key | FKIKPQHMWFZFEB-IDEBNGHGSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 12352106 |
| MSDS | msds/29763_1_3401_80_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 11-Oxahexadecan-16-olide | 3391-83-1 | 2A-9029746 |
| 1-Octen-3-ol | 3391-86-4 | 2A-9029747 |
| 4,4'-Thiodianisole | 3393-77-9 | 2A-9029753 |
| Methyl 3-bromopropionate | 3395-91-3 | 2A-9029755 |
| Didodecyl dimethyl ammonium chloride | 3401-74-9 | 2A-9029762 |
| N-Methyldipropylamine | 3405-42-3 | 2A-9029764 |
| Sophoranol | 3411-37-8 | 2A-9029768 |
| Tri(1-naphthyl)phosphine | 3411-48-1 | 2A-9029769 |
| 2-(4-Butoxyphenyl)acetamide | 3413-59-0 | 2A-9029772 |
| Norepinephrine tartrate | 3414-63-9 | 2A-9029773 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS