
CAS Number920-37-6
Synonyms2-chloro-acrylonitrile; 2-CHLOROCYANOETHYLENE; 1-Chloroaerylonitrile; MFCD00001858; 2-PROPENONITRLLE; Chloroacrylonitrile; 2-chloro-acrylonitril; NCYGU1; 2-Chloroacrylonitrile; β-Chloroacrylonitrile; 2-CHLORACRYLONITRIL; EINECS 213-055-2; 2-Chloroprop-2-enenitrile; 1-Cyanovinyl chloride; 2-chloroacrylnitrile
Molecular FormulaC23H14ClNS2
Molecular Weight403.956
Purity98%
Density1.1±0.1 g/cm3
Boiling Point89.5±13.0 °C at 760 mmHg
Melting Point−65 °C(lit.)
AppearanceTransparent yellow liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 920-37-6 |
| Catalog No. | 2A-9002970 |
| Chinese Name | 2-氯丙烯腈 |
| Synonyms | 2-chloro-acrylonitrile; 2-CHLOROCYANOETHYLENE; 1-Chloroaerylonitrile; MFCD00001858; 2-PROPENONITRLLE; Chloroacrylonitrile; 2-chloro-acrylonitril; NCYGU1; 2-Chloroacrylonitrile; β-Chloroacrylonitrile; 2-CHLORACRYLONITRIL; EINECS 213-055-2; 2-Chloroprop-2-enenitrile; 1-Cyanovinyl chloride; 2-chloroacrylnitrile |
| Molecular Formula | C23H14ClNS2 |
| Molecular Weight | 403.956 |
| Purity | 98 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 89.5±13.0 °C at 760 mmHg |
| Melting Point | −65 °C(lit.) |
| Appearance | Transparent yellow liquid |
| Storage Condition | 1. Keep the container sealed and store in a cool, |
| Packaging | II |
| HTC | 2926909090 |
| MDL Number | MFCD00159000 |
| SMILES | C=C(Cl)C#N |
| InChI | InChI=1S/C3H2ClN/c1-3(4)2-5/h1H2 |
| InChI Key | OYUNTGBISCIYPW-UHFFFAOYSA-N |
| Hazard Symbols | 3.1 |
| MSDS | msds/2970_1_920_37_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chloro-6-methylphenol | 87-64-9 | 2A-9002957 |
| 2-Chloro-6-nitrobenzonitrile | 6575-07-1 | 2A-9002962 |
| 2-Chloro-6-nitrophenol | 603-86-1 | 2A-9002963 |
| 2'-Chloroacetophenone | 2142-68-9 | 2A-9002968 |
| 2-Chloroacetylamino-2',5-dichlorobenzophenone | 14405-03-9 | 2A-9002969 |
| 2-Chlorobenzenemethanethiol | 39718-00-8 | 2A-9002974 |
| 2-Chlorobenzenesulphonyl chloride | 2905-23-9 | 2A-9002975 |
| 2-Chlorobenzyl succinimidyl carbonate | 65853-65-8 | 2A-9002979 |
| 2-Chlorobenzylamine | 89-97-4 | 2A-9002980 |
| 2-Chlorobiphenyl | 2051-60-7 | 2A-9002981 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA