CAS Number3261-62-9
Synonymsp-Methylphenethylamine; Benzeneethanamine,4-methyl; 2-(4-Methylphenyl)ethylamine; MFCD00008195; 4-Methyl-benzeneethanamine; para-methylphenethylamine; 4-Methylphenethylamine; 2-(4-Methylphenyl)ethanamine; EINECS 221-865-2; 2-p-Tolyl-ethylamine; 2-(p-Tolyl)ethylamine; 2-(p-Tolyl)ethanamine
Molecular FormulaC13H18ClN
Molecular Weight223.748
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point214.0±0.0 °C at 760 mmHg
AppearanceTransparent colorless to light yellow liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3261-62-9 |
| Catalog No. | 2A-9029610 |
| Chinese Name | 对甲基苯乙胺 |
| Synonyms | p-Methylphenethylamine; Benzeneethanamine,4-methyl; 2-(4-Methylphenyl)ethylamine; MFCD00008195; 4-Methyl-benzeneethanamine; para-methylphenethylamine; 4-Methylphenethylamine; 2-(4-Methylphenyl)ethanamine; EINECS 221-865-2; 2-p-Tolyl-ethylamine; 2-(p-Tolyl)ethylamine; 2-(p-Tolyl)ethanamine |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.748 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 214.0±0.0 °C at 760 mmHg |
| Appearance | Transparent colorless to light yellow liquid |
| Storage Condition | room temperature |
| Packaging | II |
| HTC | 2921499090 |
| PubChem ID | 89570 |
| MDL Number | MFCD00019256 |
| SMILES | Cc1ccc(CCN)cc1 |
| InChI | InChI=1S/C9H13N/c1-8-2-4-9(5-3-8)6-7-10/h2-5H,6-7,10H2,1H3 |
| InChI Key | VKJXAQYPOTYDLO-UHFFFAOYSA-N |
| Hazard Symbols | Category 8 |
| MSDS | msds/29610_1_3261_62_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Class 8 Corrosives Sub-hazards: Category 6.1: Toxic substances UN number: 2922 Proper shipping name: Corrosive Liquid, Toxic, not otherwise specified Packing grade: II |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Nitroguaiacol | 3251-56-7 | 2A-9029601 |
| 3,4,6-Tri-O-acetyl-alpha-D-galactopyranose 1,2-(methyl orthoacetate) | 3254-16-8 | 2A-9029602 |
| Difenidol hydrochloride | 3254-89-5 | 2A-9029603 |
| 4-Chloro-2-methylanisole | 3260-85-3 | 2A-9029608 |
| 3-Chloro-2-methylphenol | 3260-87-5 | 2A-9029609 |
| Nickel acetylacetonate | 3264-82-2 | 2A-9029613 |
| Chrome Blue K | 3270-25-5 | 2A-9029616 |
| Vat Green 3 | 3271-76-9 | 2A-9029619 |
| 4-Hydroxy-3-nitrobenzonitrile | 3272-08-0 | 2A-9029620 |
| Titanium dimethylamide | 3275-24-9 | 2A-9029621 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS