![1H-Imidazo[4,5-c]pyridin-4-ol structure, CAS 3243-24-1](/structures/40000/29591_2_3243_24_1.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3243-24-1 |
| Catalog No. | 2A-9029591 |
| Chinese Name | 1H-咪唑并[4,5-C]吡啶-4-醇 |
| Synonyms | imidazo<4,5-c>pyridin-4-one; imidazo<4,5-c>pyridine-4-one; 3-deazahypoxanthine |
| Molecular Formula | C6H5N3O |
| Molecular Weight | 135.13 |
| Purity | 98.00 |
| Density | 1.443g/cm3 |
| Boiling Point | 648.6ºC at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933990090 |
| PubChem ID | 94853 |
| SMILES | O=c1[nH]ccc2[nH]cnc12 |
| InChI | InChI=1S/C6H5N3O/c10-6-5-4(1-2-7-6)8-3-9-5/h1-3H,(H,7,10)(H,8,9) |
| InChI Key | ITFPSSOGLQUVLD-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1-(2-Chloroethyl)-1H-1,2,4-triazole | 3236-66-6 | 2A-9029581 |
| 2,5-Furandicarboxylic acid | 3238-40-2 | 2A-9029584 |
| 2-Propionylpyridine | 3238-55-9 | 2A-9029585 |
| 2-Propylpiperidine | 3238-60-6 | 2A-9029586 |
| 4-(2-Chloroethyl)morpholine | 3240-94-6 | 2A-9029590 |
| 2-Methyl-5-phenylpyridine | 3256-88-0 | 2A-9029604 |
| 5-Bromobenzofuran-3-one | 3260-78-4 | 2A-9029607 |
| 2-Hydroxy-5-nitropyrimidine | 3264-10-6 | 2A-9029612 |
| 2,3-Dimethyloxirane | 3266-23-7 | 2A-9029614 |
| 2,6-Diamino-4-methoxypyrimidine | 3270-97-1 | 2A-9029617 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA