
CAS Number3179-63-3
Synonyms3-(Dimethylamino)Propan-1-Ol; 3-Dimethylamino-1-propanol; 1-Dimethylamino-3-propanol; MFCD00002945; 3-(Dimethylamino)-1-propanol; γ-(Dimethylamino)propanol; 3-N,N-dimethylaminopropan-1-ol; N,N-Dimethylpropanolamine; 3-Dimethylaminopropanol; EINECS 221-659-2; 3-dimethylamino-l-propanol; 1-(Dimethylamino)propan-3-ol; 3-dimethylaminopropan-1-ol; N,N-Dimethyl-3-aminopropanol; 3-(Dimethylamino)1-propanol; 3-N,N-dimethylaminopropanol; Dimethylaminopropanol
Molecular FormulaC11H17NO
Molecular Weight179.264
Purity98.00%
Density0.9±0.1 g/cm3
Boiling Point163.5±0.0 °C at 760 mmHg
Melting Point-35 °C
AppearanceTransparent to light yellow liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3179-63-3 |
| Catalog No. | 2A-9029529 |
| Chinese Name | 3-二甲氨基-1-丙醇 |
| Synonyms | 3-(Dimethylamino)Propan-1-Ol; 3-Dimethylamino-1-propanol; 1-Dimethylamino-3-propanol; MFCD00002945; 3-(Dimethylamino)-1-propanol; γ-(Dimethylamino)propanol; 3-N,N-dimethylaminopropan-1-ol; N,N-Dimethylpropanolamine; 3-Dimethylaminopropanol; EINECS 221-659-2; 3-dimethylamino-l-propanol; 1-(Dimethylamino)propan-3-ol; 3-dimethylaminopropan-1-ol; N,N-Dimethyl-3-aminopropanol; 3-(Dimethylamino)1-propanol; 3-N,N-dimethylaminopropanol; Dimethylaminopropanol |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.264 |
| Purity | 98.00 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 163.5±0.0 °C at 760 mmHg |
| Melting Point | -35 °C |
| Appearance | Transparent to light yellow liquid |
| Water Solubility | miscible |
| Storage Condition | Storage precautions: Store in a cool, ventilated w |
| Packaging | II |
| HTC | 29221980 |
| PubChem ID | 109382 |
| MDL Number | MFCD00091135 |
| SMILES | CN(C)CCCO |
| InChI | InChI=1S/C5H13NO/c1-6(2)4-3-5-7/h7H,3-5H2,1-2H3 |
| InChI Key | PYSGFFTXMUWEOT-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/29529_1_3179_63_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Sodium 2-aminosulphanilate | 3177-22-8 | 2A-9029523 |
| 2-Amino-3-methoxybenzoic acid | 3177-80-8 | 2A-9029524 |
| 1-Methoxy-3-(2-nitrovinyl)benzene | 3179-09-7 | 2A-9029525 |
| 1-(4-Methoxyphenyl)-2-nitroethylene | 3179-10-0 | 2A-9029526 |
| Decyl methacrylate | 3179-47-3 | 2A-9029528 |
| 3-Aminopropylmethyldiethoxysilane | 3179-76-8 | 2A-9029530 |
| Ethyl L-phenylalaninate hydrochloride | 3182-93-2 | 2A-9029534 |
| Methyl p-tolyl sulfone | 3185-99-7 | 2A-9029537 |
| 1,2,5,6,9,10-Hexabromocyclododecane | 3194-55-6 | 2A-9029542 |
| N-Vinyl-N-methylacetamide | 3195-78-6 | 2A-9029543 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA