
CAS Number3173-72-6
Synonyms1,5-Naphthalene diis; 1,5-Diisocyanatonaphthalene; 1,5-NDI; NAPHTHYLENEDIISOCYANATE; MFCD00039588; 1,5-naphthalene; naphthalene diisocyanate; 1,5-naphthylene diisocyanate; desmodur15; 1,5-NAPHALENE DIISOCYANATE; Naphthalene 1,5-Diisocyanate; ndi; 1,5-diisocyanato-naphthalene; EINECS 221-641-4; Naphthyl 1,5-diisocyanate; 1,5-naphthalenediisocyanate; 5-Naphthylene diisocyanate; 1,5-naphthyldiisocyanate
Molecular FormulaC12H6N2O2
Molecular Weight210.19
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point314.7±22.0 °C at 760 mmHg
Melting Point130°C
AppearanceWhite to light yellow crystal flakes
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3173-72-6 |
| Catalog No. | 2A-9029520 |
| Chinese Name | 1,5-二异氰酸萘 |
| Synonyms | 1,5-Naphthalene diis; 1,5-Diisocyanatonaphthalene; 1,5-NDI; NAPHTHYLENEDIISOCYANATE; MFCD00039588; 1,5-naphthalene; naphthalene diisocyanate; 1,5-naphthylene diisocyanate; desmodur15; 1,5-NAPHALENE DIISOCYANATE; Naphthalene 1,5-Diisocyanate; ndi; 1,5-diisocyanato-naphthalene; EINECS 221-641-4; Naphthyl 1,5-diisocyanate; 1,5-naphthalenediisocyanate; 5-Naphthylene diisocyanate; 1,5-naphthyldiisocyanate |
| Molecular Formula | C12H6N2O2 |
| Molecular Weight | 210.19 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 314.7±22.0 °C at 760 mmHg |
| Melting Point | 130°C |
| Appearance | White to light yellow crystal flakes |
| Water Solubility | soluable |
| Storage Condition | Sealed in a cool, dry environment |
| Packaging | III |
| HTC | 2929109000 |
| SMILES | O=C=Nc1cccc2c(N=C=O)cccc12 |
| InChI | InChI=1S/C12H6N2O2/c15-7-13-11-5-1-3-9-10(11)4-2-6-12(9)14-8-16/h1-6H |
| InChI Key | SBJCUZQNHOLYMD-UHFFFAOYSA-N |
| Hazard Symbols | 6.1(b) |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Chemical name |
| Related Products in Polymer Intermediates | ||
|---|---|---|
| 3,4,5,6-Tetrahydrophthalic anhydride | 2426-02-0 | 2A-9028490 |
| 2-(Diethylamino)-ethyl acrylate | 2426-54-2 | 2A-9028492 |
| Dimethylaminoethyl acrylate | 2439-35-2 | 2A-9028537 |
| 4-Hydroxybutyl acrylate | 2478-10-6 | 2A-9028607 |
| Pentaerythritol glycidyl ether | 3126-63-4 | 2A-9029460 |
| Trimethylolpropane trimethacrylate | 3290-92-4 | 2A-9029648 |
| 1,2,3,6-Tetrahydro-4-methylphthalic anhydride | 3425-89-6 | 2A-9029785 |
| Pentaerythritol triacrylate | 3524-68-3 | 2A-9029907 |
| Bisphenol A bisallyl ether | 3739-67-1 | 2A-9030144 |
| O,O'-Dioctadecylpentaerythritol bis(phosphite) | 3806-34-6 | 2A-9030207 |
| Browse all Polymer Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA