
CAS Number3163-15-3
Synonyms2-azanylbenzene-1,3-diol; 2-amino-benzene-1,3-diol; 2-Amino-1,3-benzenediol; amino-1,3-benzenediol; 2,6-dihydroxyaniline; 2-aminoresorcinol; 2-aminobenzene-1,3-diol
Molecular FormulaC6H7NO2
Molecular Weight125.13
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point292.8±30.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3163-15-3 |
| Catalog No. | 2A-9029507 |
| Chinese Name | 2-氨基-1,3-苯二酚 |
| Synonyms | 2-azanylbenzene-1,3-diol; 2-amino-benzene-1,3-diol; 2-Amino-1,3-benzenediol; amino-1,3-benzenediol; 2,6-dihydroxyaniline; 2-aminoresorcinol; 2-aminobenzene-1,3-diol |
| Molecular Formula | C6H7NO2 |
| Molecular Weight | 125.13 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 292.8±30.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2922299090 |
| PubChem ID | 595857 |
| SMILES | Nc1c(O)cccc1O |
| InChI | InChI=1S/C6H7NO2/c7-6-4(8)2-1-3-5(6)9/h1-3,8-9H,7H2 |
| InChI Key | JEPCLNGRAIMPQV-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,3-Dimethyl-2-thiobarbituric acid | 3158-63-2 | 2A-9029499 |
| 10,11-Dihydro-11-oxodibenzo[b,f][1,4]thiazepine | 3159-07-7 | 2A-9029501 |
| Moroxydine hydrochloride | 3160-91-6 | 2A-9029504 |
| 3,4-Methylenedioxyacetophenone | 3162-29-6 | 2A-9029505 |
| 4-Nitroresorcinol | 3163-07-3 | 2A-9029506 |
| 5-Methoxy-2-methylbenzoic acid | 3168-59-0 | 2A-9029514 |
| 4,5-Dimethyl-1,2-phenylenediamine | 3171-45-7 | 2A-9029515 |
| Sodium 2-aminosulphanilate | 3177-22-8 | 2A-9029523 |
| 2-Amino-3-methoxybenzoic acid | 3177-80-8 | 2A-9029524 |
| 1-Methoxy-3-(2-nitrovinyl)benzene | 3179-09-7 | 2A-9029525 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA