
CAS Number3131-63-3
Synonyms2-Aethyl-benzofuran; 2-Ethylcoumarone; 2-ethylbenzofurane; 2-Ethyl-benzofuran; 2-Ethylbenzofuran; MFCD00047287; Benzofuran,2-ethyl; Ethyl-2-benzofuran; 2-Ethyl-1-benzofuran; EINECS 221-524-8
Molecular FormulaC10H10O
Molecular Weight146.19
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point210.0±9.0 °C at 760 mmHg
AppearanceColorless to light yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3131-63-3 |
| Catalog No. | 2A-9029465 |
| Chinese Name | 2-乙基苯并呋喃 |
| Synonyms | 2-Aethyl-benzofuran; 2-Ethylcoumarone; 2-ethylbenzofurane; 2-Ethyl-benzofuran; 2-Ethylbenzofuran; MFCD00047287; Benzofuran,2-ethyl; Ethyl-2-benzofuran; 2-Ethyl-1-benzofuran; EINECS 221-524-8 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 210.0±9.0 °C at 760 mmHg |
| Appearance | Colorless to light yellow liquid |
| Storage Condition | room temperature |
| HTC | 2932999099 |
| PubChem ID | 3140092 |
| SMILES | CCc1cc2ccccc2o1 |
| InChI | InChI=1S/C10H10O/c1-2-9-7-8-5-3-4-6-10(8)11-9/h3-7H,2H2,1H3 |
| InChI Key | KJHYAEZMOHLVCH-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1-Benzyl-4-phenylpiperazine | 3074-46-2 | 2A-9029399 |
| 1-O-Acetyl-2,3,5-tri-O-benzoyl-beta-L-ribofuranose | 3080-30-6 | 2A-9029405 |
| 1-Piperidinepropionitrile | 3088-41-3 | 2A-9029420 |
| 2-Chloromethyl-6-methylpyridine | 3099-29-4 | 2A-9029434 |
| 2-Phenylthiopyridine | 3111-54-4 | 2A-9029444 |
| 1-Benzyl-3-methylpiperazine | 3138-90-7 | 2A-9029468 |
| 2,3-Dibromothiophene | 3140-93-0 | 2A-9029471 |
| 2,3,5-Tribromothiophene | 3141-24-0 | 2A-9029472 |
| 2,3,4-Tribromothiophene | 3141-25-1 | 2A-9029473 |
| 3-Methyl-3-oxetanemethanol | 3143-02-0 | 2A-9029477 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA