
CAS Number3115-49-9
Synonyms2-(4-nonylphenoxy)ethanoic acid; (Nonylphenoxy)acetic acid; 4-nonylphenolmonoethoxycarboxylate; (4-Nonylphenoxy)acetic acid; 2-(3,4-DIFLUOROPHENYL)CYCLOPROPANE AMINE ( RACEMATE); Acetic acid,(4-nonylphenoxy); (p-Nonylphenoxy)acetic acid
Molecular FormulaC17H26O3
Molecular Weight278.387
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point406.8±20.0 °C at 760 mmHg
Melting Point95-97ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3115-49-9 |
| Catalog No. | 2A-9029450 |
| Chinese Name | (4-壬基苯氧基)乙酸 |
| Synonyms | 2-(4-nonylphenoxy)ethanoic acid; (Nonylphenoxy)acetic acid; 4-nonylphenolmonoethoxycarboxylate; (4-Nonylphenoxy)acetic acid; 2-(3,4-DIFLUOROPHENYL)CYCLOPROPANE AMINE ( RACEMATE); Acetic acid,(4-nonylphenoxy); (p-Nonylphenoxy)acetic acid |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.387 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 406.8±20.0 °C at 760 mmHg |
| Melting Point | 95-97ºC |
| HTC | 2918990090 |
| PubChem ID | 3191829 |
| SMILES | CCCCCCCCCc1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C17H26O3/c1-2-3-4-5-6-7-8-9-15-10-12-16(13-11-15)20-14-17(18)19/h10-13H,2-9,14H2,1H3,(H,18,19) |
| InChI Key | NISAHDHKGPWBEM-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Methylcyclopropene | 3100-04-7 | 2A-9029435 |
| Tetrabutylammonium hexafluorophosphate | 3109-63-5 | 2A-9029442 |
| Methyl phenyl sulfone | 3112-85-4 | 2A-9029445 |
| 5-Methyl-2-nitrobenzoic acid | 3113-72-2 | 2A-9029447 |
| Chlorobenzene-D5 | 3114-55-4 | 2A-9029448 |
| Tetrabutylphosphonium iodide | 3115-66-0 | 2A-9029451 |
| Tetrabutylphosphonium bromide | 3115-68-2 | 2A-9029452 |
| 2,5-Dimethoxybenzo-1,4-quinone | 3117-03-1 | 2A-9029454 |
| 3-Methyl-4-(methylthio)phenol | 3120-74-9 | 2A-9029456 |
| Tetraoctylammonium chloride | 3125-07-3 | 2A-9029458 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA