
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 104451-99-2 |
| Catalog No. | 2A-9002930 |
| Chinese Name | 2-氯-6-氟-3-甲基苯甲醛 |
| Synonyms | MFCD01631360; 2-chloro-6-fluoro-3-methylbenzaldehyde |
| Molecular Formula | C8H6ClFO |
| Molecular Weight | 172.58400 |
| Purity | 97 |
| Density | 1.292 g/cm3 |
| Boiling Point | 225.1ºC at 760 mmHg |
| Melting Point | 30-33 °C(lit.) |
| Appearance | Off-white crystalline solid |
| Storage Condition | Store airtight in a cool, dry warehouse. Keep away |
| HTC | 2913000090 |
| SMILES | Cc1ccc(F)c(C=O)c1Cl |
| InChI | InChI=1S/C8H6ClFO/c1-5-2-3-7(10)6(4-11)8(5)9/h2-4H,1H3 |
| InChI Key | CSYKEPRGLYWJCW-UHFFFAOYSA-N |
| MSDS | msds/2930_1_104451_99_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-Chloro-5-nitrobenzaldehyde | 6361-21-3 | 2A-9002917 |
| 2-Chloro-5-pyridylboronic acid pinacol ester | 444120-94-9 | 2A-0202227 |
| 2-Chloro-5-trifluoromethylbenzaldehyde | 82386-89-8 | 2A-9002927 |
| 2-Chloro-5-trifluoromethylbenzoic acid | 657-06-7 | 2A-9002928 |
| 2-Chloro-5-trifluoromethylbenzonitrile | 328-87-0 | 2A-9002929 |
| 2-Chloro-6-fluorobenzaldehyde oxime | 443-33-4 | 2A-9002936 |
| 2-Chloroethyl-[3-(trifluoromethyl)phenyl]sulphone | 175203-09-5 | 2A-9002986 |
| 2-Chlorophenylboronic acid | 3900-89-8 | 2A-9003014 |
| 2-chlorothiophen-3-ylboronic acid | 177734-82-6 | 2A-9003026 |
| 2-Cyano-4-(trifluoromethyl)diphenylsulphide | 52548-95-5 | 2A-9003035 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA