
CAS Number2941-64-2
SynonymsS-ethyl thiochloroformate; Ethyl thiochloroformate; MFCD00037110; S-ETHYL CHLOROTHIOLFORMATE; EINECS 220-928-1; Carbonochloridothioic acid, S-ethyl ester; Ethylthiol chloroformate; ethyl chlorothiolformate; chlorothioformic acid-S-ethyl ester; Ethyl chlorothioformate; S-ethyl chloridothiocarbonate; S-Ethyl chlorothioformate; S-Ethyl carbonochloridothioate; Carbonochloridothioic acid,S-ethyl ester
Molecular FormulaC3H5ClOS
Molecular Weight124.589
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point132.0±9.0 °C at 760 mmHg
Melting Point-60 °C
AppearanceTransparent yellow or gray-green to purple liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2941-64-2 |
| Catalog No. | 2A-9029224 |
| Chinese Name | 硫代氯甲酸乙酯 |
| Synonyms | S-ethyl thiochloroformate; Ethyl thiochloroformate; MFCD00037110; S-ETHYL CHLOROTHIOLFORMATE; EINECS 220-928-1; Carbonochloridothioic acid, S-ethyl ester; Ethylthiol chloroformate; ethyl chlorothiolformate; chlorothioformic acid-S-ethyl ester; Ethyl chlorothioformate; S-ethyl chloridothiocarbonate; S-Ethyl chlorothioformate; S-Ethyl carbonochloridothioate; Carbonochloridothioic acid,S-ethyl ester |
| Molecular Formula | C3H5ClOS |
| Molecular Weight | 124.589 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 132.0±9.0 °C at 760 mmHg |
| Melting Point | -60 °C |
| Appearance | Transparent yellow or gray-green to purple liquid |
| Water Solubility | break down |
| Storage Condition | Store in a cool, ventilated warehouse. Keep away f |
| Packaging | II |
| HTC | 29159080 |
| PubChem ID | 3133194 |
| SMILES | CCSC(=O)Cl |
| InChI | InChI=1S/C3H5ClOS/c1-2-6-3(4)5/h2H2,1H3 |
| InChI Key | QCMHWZUFWLOOGI-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl 3-mercaptopropionate | 2935-90-2 | 2A-9029217 |
| Allyl chloroformate | 2937-50-0 | 2A-9029218 |
| 1-Phenylpropan-1-amine | 2941-20-0 | 2A-9029219 |
| 2-Amino-1-cyclopentene-1-carbonitrile | 2941-23-3 | 2A-9029220 |
| 2-Methylbenzothiazol-6-amine | 2941-62-0 | 2A-9029223 |
| Diethyl cyanophosphonate | 2942-58-7 | 2A-9029231 |
| Triethoxyoctylsilane | 2943-75-1 | 2A-9029233 |
| 2,3-Dimethylanisole | 2944-49-2 | 2A-9029234 |
| Ferric oxalate | 2944-66-3 | 2A-9029235 |
| 5-Methoxy-2-methylbenzoselenazole | 2946-17-0 | 2A-9029237 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA