
CAS Number33406-96-1
Synonyms2-Chlor-5-fluor-toluol; 1-Chloro-4-fluoro-2-methylbenzene; 6-Chlor-3-fluortoluol; EINECS 251-508-6; GR DF B1; 5-fluoro-2-chlorotoluene; 2-Chloro-5-fluorotoluene; MFCD00040853; 3-FLUORO-6-CHLOROTOLUENE; Benzene,1-chloro-4-fluoro-2-methyl
Molecular FormulaC7H6Cl1F1
Molecular Weight144.58
Purity98%
Density1.2±0.1 g/cm3
Boiling Point161.0±20.0 °C at 760 mmHg
AppearanceColorless to light yellow liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 33406-96-1 |
| Catalog No. | 2A-9002909 |
| Chinese Name | 2-氯-5-氟甲苯 |
| Synonyms | 2-Chlor-5-fluor-toluol; 1-Chloro-4-fluoro-2-methylbenzene; 6-Chlor-3-fluortoluol; EINECS 251-508-6; GR DF B1; 5-fluoro-2-chlorotoluene; 2-Chloro-5-fluorotoluene; MFCD00040853; 3-FLUORO-6-CHLOROTOLUENE; Benzene,1-chloro-4-fluoro-2-methyl |
| Molecular Formula | C7H6Cl1F1 |
| Molecular Weight | 144.58 |
| Purity | 98 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 161.0±20.0 °C at 760 mmHg |
| Appearance | Colorless to light yellow liquid |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| Packaging | III |
| HTC | 2903999090 |
| MDL Number | MFCD00040853 |
| SMILES | Cc1cc(F)ccc1Cl |
| InChI | InChI=1S/C7H6ClF/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
| InChI Key | NIOGDCDTKPQEAT-UHFFFAOYSA-N |
| Hazard Symbols | 3 |
| MSDS | msds/2909_1_33406_96_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations Classification: Class 3 Flammable Liquids. UN number: 1993 Proper shipping name: Flammable Liquid, not otherwise specified Packing grade: III |
| Related Products in Industrial Applications | ||
|---|---|---|
| 2-Bromo-5-iodotoluene | 202865-85-8 | 2A-9002690 |
| 2-Bromo-6-chlorotoluene | 62356-27-8 | 2A-9002704 |
| 2-Bromo-6-fluorotoluene | 1422-54-4 | 2A-9002712 |
| 2-Butynyl 4-toluenesulfonate | 56563-37-2 | 2A-9002771 |
| 2-Chloro-4-fluorotoluene | 452-73-3 | 2A-9002870 |
| 2-dimethylamino-1, 3-dioxohexane | 2A-103066 | 2A-9003066 |
| 2-Fluoro-3-iodotoluene | 2A-103097 | 2A-9003097 |
| 2-Fluoro-3-nitrotoluene | 437-86-5 | 2A-9003102 |
| 2-Fluoro-4-iodotoluene | 39998-81-7 | 2A-9003112 |
| 2-Fluoro-4-nitrotoluene | 1427-07-2 | 2A-9003126 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA