
CAS Number2834-92-6
Synonyms2-Hydroxy-1-aminonaphthalene; 1-Amino-2-hydroxynaphthalene; 1-amino-2-naphthol hydrochloride; 2-Naphthol,1-amino; o-hydroxynaphthylamine; EINECS 220-606-0; 1-Amino-2-naphthol; aminohydroxynaphthalene; 2-Naphthalenol,1-amino; 1-amino-naphthalen-2-ol; MFCD00628991
Molecular FormulaC10H9O1N1
Molecular Weight159.19
Purity98.00%
Density1.281 g/cm3
Boiling Point336.8ºC at 760 mmHg
Melting Point51ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2834-92-6 |
| Catalog No. | 2A-9029057 |
| Chinese Name | 1-氨基-2-萘酚 |
| Synonyms | 2-Hydroxy-1-aminonaphthalene; 1-Amino-2-hydroxynaphthalene; 1-amino-2-naphthol hydrochloride; 2-Naphthol,1-amino; o-hydroxynaphthylamine; EINECS 220-606-0; 1-Amino-2-naphthol; aminohydroxynaphthalene; 2-Naphthalenol,1-amino; 1-amino-naphthalen-2-ol; MFCD00628991 |
| Molecular Formula | C10H9O1N1 |
| Molecular Weight | 159.19 |
| Purity | 98.00 |
| Density | 1.281 g/cm3 |
| Boiling Point | 336.8ºC at 760 mmHg |
| Melting Point | 51ºC |
| HTC | 2922299090 |
| PubChem ID | 73695 |
| MDL Number | MFCD00628991 |
| SMILES | Nc1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C10H9NO/c11-10-8-4-2-1-3-7(8)5-6-9(10)12/h1-6,12H,11H2 |
| InChI Key | FHMMQQXRSYSWCM-UHFFFAOYSA-N |
| MSDS | msds/29057_1_2834_92_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,5-Dimethylbenzoselenazole | 2818-89-5 | 2A-9029045 |
| Flumethasone-17-acetate | 2823-42-9 | 2A-9029047 |
| exo-Tetrahydrocyclopentadiene | 2825-82-3 | 2A-9029048 |
| endo-Tetrahydrodicyclopentadiene | 2825-83-4 | 2A-9029049 |
| 11-Bromoundecanoic acid | 2834-05-1 | 2A-9029056 |
| 2-Amino-2-phenylacetic acid | 2835-06-5 | 2A-9029058 |
| p-Aminobenzamide | 2835-68-9 | 2A-9029059 |
| 3-Aminobenzophenone | 2835-78-1 | 2A-9029061 |
| DL-2-Aminobutyric acid | 2835-81-6 | 2A-9029062 |
| DL-3-Aminobutyric acid | 2835-82-7 | 2A-9029063 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA