
CAS Number2754-41-8
Synonyms1,2,4,5-Cyclohexanetetracarboxylic Dianhydride; 1,2,4,5-Cyclohexanetetracarboxylic acid dianhydride; cyclohexane-1,2,4,5-tetracarboxylic acid-1,2,4,5-dianhydride; Tetrahydrobenzo[1,2-c:4,5-c']difuran-1,3,5,7(3aH,7aH)-tetraone; Hexahydro-1H,3H-furo[3,4-f][2]benzofuran-1,3,5,7-tetrone; Cyclohexan-1,2,4,5-tetracarbonsaeure-1,2,4,5-dianhydrid; cyclohexanetetracarboxylic dianhydride; HPMDA
Molecular FormulaC10H8O6
Molecular Weight224.17
Purity98.00%
Density1.6±0.1 g/cm3
Boiling Point517.5±50.0 °C at 760 mmHg
AppearanceWhite to off-white solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2754-41-8 |
| Catalog No. | 2A-9028978 |
| Chinese Name | 1,2,4,5-环己烷四甲酸二酐 |
| Synonyms | 1,2,4,5-Cyclohexanetetracarboxylic Dianhydride; 1,2,4,5-Cyclohexanetetracarboxylic acid dianhydride; cyclohexane-1,2,4,5-tetracarboxylic acid-1,2,4,5-dianhydride; Tetrahydrobenzo[1,2-c:4,5-c']difuran-1,3,5,7(3aH,7aH)-tetraone; Hexahydro-1H,3H-furo[3,4-f][2]benzofuran-1,3,5,7-tetrone; Cyclohexan-1,2,4,5-tetracarbonsaeure-1,2,4,5-dianhydrid; cyclohexanetetracarboxylic dianhydride; HPMDA |
| Molecular Formula | C10H8O6 |
| Molecular Weight | 224.17 |
| Purity | 98.00 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 517.5±50.0 °C at 760 mmHg |
| Appearance | White to off-white solid |
| Storage Condition | room temperature, sealed |
| HTC | 2932190090 |
| PubChem ID | 30995238 |
| SMILES | O=C1OC(=O)C2CC3C(=O)OC(=O)C3CC12 |
| InChI | InChI=1S/C10H8O6/c11-7-3-1-4-6(10(14)16-8(4)12)2-5(3)9(13)15-7/h3-6H,1-2H2 |
| InChI Key | LJMPOXUWPWEILS-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-[(2-Chloroethyl)ethylamino]-benzaldehyde | 2643-07-4 | 2A-9028853 |
| Methyl 3-oxo-4-androstene-17beta-carboxylate | 2681-55-2 | 2A-9028889 |
| Cyclohexanecarboxylic acid chloride | 2719-27-9 | 2A-9028935 |
| 3-(Trifluoromethyl)benzylamine | 2740-83-2 | 2A-9028957 |
| cis-5-Norbornene-exo-2,3-dicarboxylic anhydride | 2746-19-2 | 2A-9028965 |
| 1-Amino-1-cyclohexanecarboxylic acid | 2756-85-6 | 2A-9028980 |
| Isophthalic dihydrazide | 2760-98-7 | 2A-9028985 |
| Methyl cyclopropane carboxylate | 2868-37-3 | 2A-9029107 |
| 2-Propoxybenzaldehyde | 2893-49-4 | 2A-9029141 |
| 3,5-Dinitrobenzohydrazide | 2900-63-2 | 2A-9029158 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA