
CAS Number2525-05-5
Synonyms4-Butyl-1,2-benzenediol; 1,2-Benzenediol,4-butyl; 4-n-butylcatechol; 1,2-dihydroxy-4-butylbenzene; 3.4-Dihydroxy-1-butyl-benzol; 4-butyl-pyrocatechol; 4-Butyl-brenzcatechin
Molecular FormulaC10H14O2
Molecular Weight166.22
Purity98.00%
Density1.092
Boiling Point300ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2525-05-5 |
| Catalog No. | 2A-9028691 |
| Chinese Name | 4-丁基苯-1,2-二醇 |
| Synonyms | 4-Butyl-1,2-benzenediol; 1,2-Benzenediol,4-butyl; 4-n-butylcatechol; 1,2-dihydroxy-4-butylbenzene; 3.4-Dihydroxy-1-butyl-benzol; 4-butyl-pyrocatechol; 4-Butyl-brenzcatechin |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 |
| Purity | 98.00 |
| Density | 1.092 |
| Boiling Point | 300ºC |
| Storage Condition | room temperature |
| HTC | 2907299090 |
| PubChem ID | 42680565 |
| MDL Number | MFCD00873218 |
| SMILES | CCCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C10H14O2/c1-2-3-4-8-5-6-9(11)10(12)7-8/h5-7,11-12H,2-4H2,1H3 |
| InChI Key | LAVPWYRENKSWJM-UHFFFAOYSA-N |
| MSDS | msds/28691_1_2525_05_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Diethyl chlorothiophosphate | 2524-04-1 | 2A-9028685 |
| Ethyl picolinate | 2524-52-9 | 2A-9028686 |
| Diphenyl chlorophosphate | 2524-64-3 | 2A-9028687 |
| 3-Nitrothioanisole | 2524-76-7 | 2A-9028689 |
| 3-Acetamidothioanisole | 2524-78-9 | 2A-9028690 |
| 2-Cyanoethylmethyldimethoxysilane | 2526-61-6 | 2A-9028693 |
| Monobenzyl phthalate | 2528-16-7 | 2A-9028695 |
| Heptanoyl chloride | 2528-61-2 | 2A-9028696 |
| 3-Glycidoxypropyltrimethoxysilane | 2530-83-8 | 2A-9028699 |
| (N,N-Dimethylaminopropyl)trimethoxysilane | 2530-86-1 | 2A-9028701 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA