CAS Number2516-96-3
Synonyms2-Chlor-5-nitro-benzoesaeure; EINECS 219-739-7; 2-Chloro-5-nitrobenzoic; RARECHEM AL BO 0234; 2-carboxy-4-nitro-chlorobenzene; 2-Chloro-5-nitrobenzoicacid; 2-chloro-5-nitro-benzoicaci; 2,5-CNBA; 2-chloro-5-nitrobenzoyl alcohol; 2-Chlor-5-nitrobenzoesure; 2-Chloro-5-nitrobenzoic acid; 2-chloro-5-nitro-benzoic acid; MFCD00007294; 6-Chloro-3-nitrobenzoic acid; DIETHYL AZELATE,TECH.; 5-NITRO-2-CHLOROBENZOIC ACID
Molecular FormulaClC6H3(NO2)CO2H
Molecular Weight201.56
Purity98.00%
Density1.6±0.1 g/cm3
Boiling Point356.5±27.0 °C at 760 mmHg
Melting Point165-168 °C(lit.)
AppearanceYellow to brown crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2516-96-3 |
| Catalog No. | 2A-9028670 |
| Chinese Name | 2-氯-5-硝基苯甲酸 |
| Synonyms | 2-Chlor-5-nitro-benzoesaeure; EINECS 219-739-7; 2-Chloro-5-nitrobenzoic; RARECHEM AL BO 0234; 2-carboxy-4-nitro-chlorobenzene; 2-Chloro-5-nitrobenzoicacid; 2-chloro-5-nitro-benzoicaci; 2,5-CNBA; 2-chloro-5-nitrobenzoyl alcohol; 2-Chlor-5-nitrobenzoesure; 2-Chloro-5-nitrobenzoic acid; 2-chloro-5-nitro-benzoic acid; MFCD00007294; 6-Chloro-3-nitrobenzoic acid; DIETHYL AZELATE,TECH.; 5-NITRO-2-CHLOROBENZOIC ACID |
| Molecular Formula | ClC6H3(NO2)CO2H |
| Molecular Weight | 201.56 |
| Purity | 98.00 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 356.5±27.0 °C at 760 mmHg |
| Melting Point | 165-168 °C(lit.) |
| Appearance | Yellow to brown crystalline powder |
| Storage Condition | Keep container sealed, placed in a tight-fitting c |
| HTC | 2916399090 |
| PubChem ID | 329823586 |
| SMILES | O=C(O)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C7H4ClNO4/c8-6-2-1-4(9(12)13)3-5(6)7(10)11/h1-3H,(H,10,11) |
| InChI Key | QUEKGYQTRJVEQC-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Antazoline hydrochloride | 2508-72-7 | 2A-9028652 |
| (3,5-Dimethylisoxazol-4-yl)acetic acid | 2510-27-2 | 2A-9028657 |
| Dipropyl chlorophosphate | 2510-89-6 | 2A-9028660 |
| O-Ethyl phenylphosphinate | 2511-09-3 | 2A-9028661 |
| 2-Butoxyacetic acid | 2516-93-0 | 2A-9028668 |
| 3,3,3-Trifluoropropionic acid | 2516-99-6 | 2A-9028671 |
| 3-Methoxy-1-butanol | 2517-43-3 | 2A-9028673 |
| 3-Aminophthalimide | 2518-24-3 | 2A-9028674 |
| 5-Ethylbarbituric acid | 2518-72-1 | 2A-9028675 |
| 4-Chlorothiobenzamide | 2521-24-6 | 2A-9028678 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS