
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 81112-09-6 |
| Catalog No. | 2A-9002867 |
| Chinese Name | 3-氯-1-(4-氟苯基)丙酮 |
| Synonyms | 2-Chloro-4'-fluoropropiophenone; MFCD00060275; 2-chloro-p-fluoropropiophenone |
| Molecular Formula | C9H8O1Cl1F1 |
| Molecular Weight | 186.61 |
| Purity | 98 |
| Density | 1.216 g/cm3 |
| Boiling Point | 255.5ºC at 760 mmHg |
| Melting Point | 50-52ºC |
| Appearance | white crystal |
| Storage Condition | 2-8°C, inert gas |
| HTC | 2914700090 |
| MDL Number | MFCD00060275 |
| SMILES | CC(Cl)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C9H8ClFO/c1-6(10)9(12)7-2-4-8(11)5-3-7/h2-6H,1H3 |
| InChI Key | AGQLOTJUTCKLOE-UHFFFAOYSA-N |
| MSDS | msds/2867_1_81112_09_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chloro-4-fluorobenzyl chloride | 93286-22-7 | 2A-9002861 |
| 2-Chloro-4-fluorobenzylamine | 15205-11-5 | 2A-9002862 |
| 2-Chloro-4-fluoronitrobenzene | 2106-50-5 | 2A-9002863 |
| 2-Chloro-4-fluorophenol | 1996-41-4 | 2A-9002864 |
| 2-Chloro-4-fluorophenylacetonitrile | 75279-56-0 | 2A-9002865 |
| 2-Chloro-4-fluorothiophenol | 175277-99-3 | 2A-9002869 |
| 2-Chloro-4-iodoaniline | 42016-93-3 | 2A-9002875 |
| 2-Chloro-4-methoxy-1-methylbenzene | 54788-38-4 | 2A-9002877 |
| 2-Chloro-4-methoxyphenol | 18113-03-6 | 2A-9002878 |
| 2-Chloro-4-methylaniline | 615-65-6 | 2A-9002881 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA