![2-[(4-Aminophenyl)sulfonyl]ethyl hydrogen sulfate structure, CAS 2494-89-5](/structures/40000/28639_2_2494_89_5.png)
CAS Number2494-89-5
SynonymsEthanol,2-sulfanilyl-,hydrogen sulfate (ester); Ethanol,2-[(4-aminophenyl)sulfonyl]-,hydrogen sulfate (ester); 4-(-sulfatoethylsulfonyl)aniline; {2-[(4-aminobenzene)sulfonyl]ethoxy}sulfonic acid; 2-((p-Aminophenyl)sulphonyl)ethyl hydrogensulphate; 4-aminophenyl 2"-sulphatoethyl sulphone; EINECS 219-669-7; 2-[(4-aminophenyl)sulfonyl]ethyl hydrogen sulfate; 4-((2-(sulfooxy)-ethyl)-sulfonyl)-phenylamine; 4-((2-Sulfatoethyl)sulfonyl)aniline
Molecular FormulaC8H11NO6S2
Molecular Weight281.31
Purity98.00%
Density1.608g/cm3
AppearanceYellow to gray to brown solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2494-89-5 |
| Catalog No. | 2A-9028639 |
| Chinese Name | 4-(乙基硫酸盐磺酰基)苯胺 |
| Synonyms | Ethanol,2-sulfanilyl-,hydrogen sulfate (ester); Ethanol,2-[(4-aminophenyl)sulfonyl]-,hydrogen sulfate (ester); 4-(-sulfatoethylsulfonyl)aniline; {2-[(4-aminobenzene)sulfonyl]ethoxy}sulfonic acid; 2-((p-Aminophenyl)sulphonyl)ethyl hydrogensulphate; 4-aminophenyl 2"-sulphatoethyl sulphone; EINECS 219-669-7; 2-[(4-aminophenyl)sulfonyl]ethyl hydrogen sulfate; 4-((2-(sulfooxy)-ethyl)-sulfonyl)-phenylamine; 4-((2-Sulfatoethyl)sulfonyl)aniline |
| Molecular Formula | C8H11NO6S2 |
| Molecular Weight | 281.31 |
| Purity | 98.00 |
| Density | 1.608g/cm3 |
| Appearance | Yellow to gray to brown solid |
| Storage Condition | Room temperature, inert gas, protected from light |
| HTC | 2922199090 |
| PubChem ID | 3217417 |
| SMILES | Nc1ccc(S(=O)(=O)CCOS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C8H11NO6S2/c9-7-1-3-8(4-2-7)16(10,11)6-5-15-17(12,13)14/h1-4H,5-6,9H2,(H,12,13,14) |
| InChI Key | IALORYHODRVWKZ-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Allylnaphthalene | 2489-86-3 | 2A-9028629 |
| N,N-Dimethylglycine hydrochloride | 2491-06-7 | 2A-9028631 |
| N-Formylglycine | 2491-15-8 | 2A-9028632 |
| N-Cyclohexyl-N'-[(N-methylmorpholinio)ethyl]carbodiimide tosylate | 2491-17-0 | 2A-9028633 |
| 2-Bromo-4'-hydroxyacetophenone | 2491-38-5 | 2A-9028636 |
| Benzyl acrylate | 2495-35-4 | 2A-9028640 |
| Benzyl methacrylate | 2495-37-6 | 2A-9028641 |
| N-Acetyl-L-histidine | 2497-02-1 | 2A-9028643 |
| trans-2-Hexenyl acetate | 2497-18-9 | 2A-9028644 |
| 2-Chloro-3,5-dinitrobenzoic acid | 2497-91-8 | 2A-9028645 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA