
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2474-07-9 |
| Catalog No. | 2A-9028599 |
| Chinese Name | 2-(4-溴苯氧基)-N,N-二甲基乙胺 |
| Synonyms | [2-(4-Bromo-phenoxy)-ethyl]-dimethyl-; amine; 2-(4-Bromophenoxy)-N,N-dimethylethanamine |
| Molecular Formula | C10H14O1N1Br1 |
| Molecular Weight | 244.13 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 286.7±20.0 °C at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2922299090 |
| PubChem ID | 3185601 |
| MDL Number | MFCD00274471 |
| SMILES | CN(C)CCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C10H14BrNO/c1-12(2)7-8-13-10-5-3-9(11)4-6-10/h3-6H,7-8H2,1-2H3 |
| InChI Key | MOVOYJFCKMYLHQ-UHFFFAOYSA-N |
| MSDS | msds/28599_1_2474_07_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Didodecyl sulfide | 2469-45-6 | 2A-9028593 |
| 1,3-Bis(3-aminopropyl)-1,1,3,3-tetramethyldisiloxane | 2469-55-8 | 2A-9028594 |
| 3-Oxobutanenitrile | 2469-99-0 | 2A-9028595 |
| 6,7-Dimethoxy-2-tetralone | 2472-13-1 | 2A-9028596 |
| Bis(tetrabutylammonium) sulphate | 2472-88-0 | 2A-9028598 |
| Vat Blue 4B | 2475-31-2 | 2A-9028600 |
| Vat Brown 1 | 2475-33-4 | 2A-9028601 |
| 4'-Amino-2'-hydroxyacetophenone | 2476-29-1 | 2A-9028604 |
| 5-Bromo-2-methoxybenzoic acid | 2476-35-9 | 2A-9028605 |
| Acetosyringone | 2478-38-8 | 2A-9028608 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA