
CAS Number2461-46-3
Synonyms4,4'-dihydroxybiphenyl diglycidyl ether; diglycidyl ether of 4,4'-dihydroxybiphenyl; EINECS 219-556-2; 4,4'-diglycidyloxybiphenyl
Molecular FormulaC18H18O4
Molecular Weight298.33300
Purity98.00%
Density1.226g/cm3
Boiling Point473.6ºC at 760mmHg
Melting Point156 °C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2461-46-3 |
| Catalog No. | 2A-9028580 |
| Chinese Name | 4,4'-联苯双酚二缩水甘油醚 |
| Synonyms | 4,4'-dihydroxybiphenyl diglycidyl ether; diglycidyl ether of 4,4'-dihydroxybiphenyl; EINECS 219-556-2; 4,4'-diglycidyloxybiphenyl |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.33300 |
| Purity | 98.00 |
| Density | 1.226g/cm3 |
| Boiling Point | 473.6ºC at 760mmHg |
| Melting Point | 156 °C |
| Storage Condition | 2-8°C |
| HTC | 2910900090 |
| PubChem ID | 7394740 |
| SMILES | C1OC1COc2ccc(cc2)c3ccc(OCC4CO4)cc3 |
| InChI | InChI=1S/C18H18O4/c1-5-15(19-9-17-11-21-17)6-2-13(1)14-3-7-16(8-4-14)20-10-18-12-22-18/h1-8,17-18H,9-12H2 |
| InChI Key | InChIKey=OZRVXYJWUUMVOW-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2910900090. epoxides, epoxyalcohols, epoxyphenols and epoxyethers, with a three-membered ring, and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl picolinate | 2459-07-6 | 2A-9028574 |
| Methyl isonicotinate | 2459-09-8 | 2A-9028575 |
| 2,5-Di-tert-butyl-1,4-benzoquinone | 2460-77-7 | 2A-9028576 |
| 2-Ethylhexyl glycidyl ether | 2461-15-6 | 2A-9028577 |
| Glycidyl butyrate | 2461-40-7 | 2A-9028578 |
| 2-Mercapto-1-phenylethanone | 2462-02-4 | 2A-9028581 |
| Benzyl glycinate hydrochloride | 2462-31-9 | 2A-9028582 |
| 2-Nonenal | 2463-53-8 | 2A-9028585 |
| 2-Undecenal | 2463-77-6 | 2A-9028586 |
| Chlorflurecol | 2464-37-1 | 2A-9028587 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA