
CAS Number700-35-6
Synonyms1-(2-Chloro-4-fluorophenyl)ethanone; GR CF FV1; 1-(2-Chloro-4-fluorophenyl)-1-ethanone; 1-(2-Chloro-4-fluorophenyl)ethan-1-one; MFCD00042202
Molecular FormulaC8H6ClFO
Molecular Weight172.584
Purity98%
Density1.3±0.1 g/cm3
Boiling Point203.4±20.0 °C at 760 mmHg
AppearanceTransparent colorless to light yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 700-35-6 |
| Catalog No. | 2A-9002847 |
| Chinese Name | 2-氯-4-氟苯乙酮 |
| Synonyms | 1-(2-Chloro-4-fluorophenyl)ethanone; GR CF FV1; 1-(2-Chloro-4-fluorophenyl)-1-ethanone; 1-(2-Chloro-4-fluorophenyl)ethan-1-one; MFCD00042202 |
| Molecular Formula | C8H6ClFO |
| Molecular Weight | 172.584 |
| Purity | 98 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 203.4±20.0 °C at 760 mmHg |
| Appearance | Transparent colorless to light yellow liquid |
| Storage Condition | Store in a sealed container in a cool, dry place. |
| HTC | 2914700090 |
| SMILES | CC(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C8H6ClFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 |
| InChI Key | CSEMGLVHVZRXQF-UHFFFAOYSA-N |
| MSDS | msds/2847_1_700_35_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chloro-4,6-dinitrophenol | 946-31-6 | 2A-9002841 |
| 2-Chloro-4-aminobenzoic acid | 2457-76-3 | 2A-9002842 |
| 2-Chloro-4-aminophenol | 3964-52-1 | 2A-9002843 |
| 2-Chloro-4-fluoro-5-methylaniline | 124185-35-9 | 2A-9002845 |
| 2-Chloro-4-fluoro-5-nitrophenol | 84478-75-1 | 2A-9002846 |
| 2-Chloro-4'-fluoroacetophenone | 456-04-2 | 2A-9002848 |
| 2-Chloro-4-fluoroaniline | 2106-02-7 | 2A-9002849 |
| 2-Chloro-4-fluoroanisole | 2267-25-6 | 2A-9002850 |
| 2-Chloro-4-fluorobenzamide | 88578-90-9 | 2A-9002852 |
| 2-Chloro-4-fluorobenzenesulphonyl chloride | 85958-57-2 | 2A-9002853 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA