
CAS Number2268-15-7
Synonyms2,3,5-Trifluor-phenol; 2,3,4,6-TETRA-O-BENZYL-A-D-GLUCOPYRANOSYL FLUORIDE; MFCD00075416; 2 3 5-TRIFLUOROPHENOL
Molecular FormulaC6H3F3O
Molecular Weight148.08
Purity98.00%
Density1.457 g/mL at 25 °C(lit.)
Boiling Point57 °C29 mm Hg(lit.)
Melting Point29 °C(lit.)
AppearanceTransparent light yellow liquid after melting point
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2268-15-7 |
| Catalog No. | 2A-9028239 |
| Chinese Name | 2,3,5-三氟苯酚 |
| Synonyms | 2,3,5-Trifluor-phenol; 2,3,4,6-TETRA-O-BENZYL-A-D-GLUCOPYRANOSYL FLUORIDE; MFCD00075416; 2 3 5-TRIFLUOROPHENOL |
| Molecular Formula | C6H3F3O |
| Molecular Weight | 148.08 |
| Purity | 98.00 |
| Density | 1.457 g/mL at 25 °C(lit.) |
| Boiling Point | 57 °C29 mm Hg(lit.) |
| Melting Point | 29 °C(lit.) |
| Appearance | Transparent light yellow liquid after melting point |
| Storage Condition | Keep container sealed, placed in a tight-fitting c |
| Packaging | III |
| HTC | 29081000 |
| PubChem ID | 3152663 |
| SMILES | Oc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C6H3F3O/c7-3-1-4(8)6(9)5(10)2-3/h1-2,10H |
| InChI Key | JNZQXSIWHRRMNO-UHFFFAOYSA-N |
| Hazard Symbols | 4.1 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl 2,2-difluoro-2-phenylacetate | 2248-46-6 | 2A-9028216 |
| Formyl acetate | 2258-42-6 | 2A-9028229 |
| 1H,1H,7H-Dodecafluoroheptyl methacrylate | 2261-99-6 | 2A-9028230 |
| 2,2-Difluoro-3-oxobutyric acid ethyl ester | 2266-48-0 | 2A-9028234 |
| 2-Nitro-4-(trifluoromethoxy)aniline | 2267-23-4 | 2A-9028235 |
| Aluminium tri-sec-butoxide | 2269-22-9 | 2A-9028244 |
| 5-Phenylvaleric acid | 2270-20-4 | 2A-9028245 |
| 3,7-Dimethyl-6-octen-3-ol | 2270-57-7 | 2A-9028246 |
| Butylhydroxyoxo-stannane | 2273-43-0 | 2A-9028247 |
| Dimethyloxostannane | 2273-45-2 | 2A-9028248 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA