
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 219897-38-8 |
| Catalog No. | 2A-9000282 |
| Chinese Name | (S)-(+)-1-(Alpha-氨基苄基)-2-萘酚 |
| Synonyms | unii-690biu4wik |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.30700 |
| Purity | 98 |
| Boiling Point | 451.1ºC at 760mmHg |
| Melting Point | 133-137ºC |
| Storage Condition | Sealed in a cool, dry environment at 4 ºC |
| HTC | 2922299090 |
| SMILES | NC(c1ccccc1)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C17H15NO/c18-17(13-7-2-1-3-8-13)16-14-9-5-4-6-12(14)10-11-15(16)19/h1-11,17,19H,18H2/p+1/t17-/m0/s1 |
| InChI Key | PZMIGEOOGFFCNT-KRWDZBQOSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| (S)-(-)-alpha,alpha-Diphenyl-2-pyrrolidinemethanol | 112068-01-6 | 2A-9000277 |
| (S)-(-)-beta-Methylphenethylamine | 17596-79-1 | 2A-9000278 |
| (S)-(-)-Ethylbenzylamine | 3789-59-1 | 2A-9000279 |
| (S)-(-)-Indoline-2-carboxylic acid | 79815-20-6 | 2A-9000280 |
| (S)-(-)-N-Benzyl-alpha-methylbenzylamine | 17480-69-2 | 2A-9000281 |
| (S)-(+)-1,3-Butanediol | 24621-61-2 | 2A-9000283 |
| (S)-(+)-1-Amino-2-propanol | 2799-17-9 | 2A-9000284 |
| (S)-(+)-1-Benzyl-3-aminopyrrolidine | 114715-38-7 | 2A-9000285 |
| (S)-(+)-2-(9-Fluorenylmethoxycarbonyl)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid | 136030-33-6 | 2A-9000286 |
| (S)-(+)-2-(Benzyloxycarbonyl)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid | 79261-58-8 | 2A-9000287 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA